[4-(1H-benzimidazol-2-yl)-phenyl]-(4,6-di-morpholin-4-yl-[1,3,5]triazin-2-yl)-amine

ID: ALA3809547

PubChem CID: 127044244

Max Phase: Preclinical

Molecular Formula: C24H26N8O2

Molecular Weight: 458.53

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  c1ccc2[nH]c(-c3ccc(Nc4nc(N5CCOCC5)nc(N5CCOCC5)n4)cc3)nc2c1

Standard InChI:  InChI=1S/C24H26N8O2/c1-2-4-20-19(3-1)26-21(27-20)17-5-7-18(8-6-17)25-22-28-23(31-9-13-33-14-10-31)30-24(29-22)32-11-15-34-16-12-32/h1-8H,9-16H2,(H,26,27)(H,25,28,29,30)

Standard InChI Key:  XSEURYWDBGRSAP-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 34 39  0  0  0  0  0  0  0  0999 V2000
    8.5716    0.4033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.7060    1.8887    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.2114    1.7609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3536    2.9915    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.9903    4.3496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4848    4.4773    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.3427    3.2468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8380    3.3746    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.4770    4.7318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9717    4.8571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8276    3.6252    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.1888    2.2681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6940    2.1428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1320    5.5807    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6372    5.4555    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7813    6.6873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4201    8.0445    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9149    8.1698    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7708    6.9380    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0761    0.2776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4347   -1.0784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9397   -1.2009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0896    0.0290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7275    1.3885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2225    1.5111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  2  7  2  0
  8  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
  8 13  1  0
  7  8  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 14 19  1  0
  5 14  1  0
  1  3  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 20 25  2  0
 26 27  2  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 26 30  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 29 34  2  0
 28 31  2  0
 23 26  1  0
  1 20  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3809547

    ---

Associated Targets(non-human)

ALB Serum albumin (1163 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 458.53Molecular Weight (Monoisotopic): 458.2179AlogP: 2.83#Rotatable Bonds: 5
Polar Surface Area: 104.32Molecular Species: NEUTRALHBA: 9HBD: 2
#RO5 Violations: HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 11.56CX Basic pKa: 7.32CX LogP: 4.42CX LogD: 4.16
Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.47Np Likeness Score: -1.38

References

1. Singla P, Luxami V, Paul K..  (2016)  Synthesis and in vitro evaluation of novel triazine analogues as anticancer agents and their interaction studies with bovine serum albumin.,  117  [PMID:27089212] [10.1016/j.ejmech.2016.03.088]

Source