The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[4-(1H-benzimidazol-2-yl)-phenyl]-(4,6-di-morpholin-4-yl-[1,3,5]triazin-2-yl)-amine ID: ALA3809547
PubChem CID: 127044244
Max Phase: Preclinical
Molecular Formula: C24H26N8O2
Molecular Weight: 458.53
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: c1ccc2[nH]c(-c3ccc(Nc4nc(N5CCOCC5)nc(N5CCOCC5)n4)cc3)nc2c1
Standard InChI: InChI=1S/C24H26N8O2/c1-2-4-20-19(3-1)26-21(27-20)17-5-7-18(8-6-17)25-22-28-23(31-9-13-33-14-10-31)30-24(29-22)32-11-15-34-16-12-32/h1-8H,9-16H2,(H,26,27)(H,25,28,29,30)
Standard InChI Key: XSEURYWDBGRSAP-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 39 0 0 0 0 0 0 0 0999 V2000
8.5716 0.4033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.7060 1.8887 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2114 1.7609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3536 2.9915 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9903 4.3496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4848 4.4773 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3427 3.2468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8380 3.3746 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4770 4.7318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9717 4.8571 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8276 3.6252 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1888 2.2681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6940 2.1428 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1320 5.5807 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6372 5.4555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7813 6.6873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4201 8.0445 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.9149 8.1698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7708 6.9380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0761 0.2776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4347 -1.0784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9397 -1.2009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0896 0.0290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7275 1.3885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2225 1.5111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
2 7 2 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
8 13 1 0
7 8 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
14 19 1 0
5 14 1 0
1 3 1 0
20 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
20 25 2 0
26 27 2 0
27 28 1 0
28 29 1 0
29 30 1 0
26 30 1 0
31 32 1 0
32 33 2 0
33 34 1 0
29 34 2 0
28 31 2 0
23 26 1 0
1 20 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 458.53Molecular Weight (Monoisotopic): 458.2179AlogP: 2.83#Rotatable Bonds: 5Polar Surface Area: 104.32Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 11.56CX Basic pKa: 7.32CX LogP: 4.42CX LogD: 4.16Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.47Np Likeness Score: -1.38
References 1. Singla P, Luxami V, Paul K.. (2016) Synthesis and in vitro evaluation of novel triazine analogues as anticancer agents and their interaction studies with bovine serum albumin., 117 [PMID:27089212 ] [10.1016/j.ejmech.2016.03.088 ]