N-(1-acetyl-1H-indol-3-yl)-N-(5-methoxy-2-methylphenyl)benzamide

ID: ALA3809558

PubChem CID: 127045563

Max Phase: Preclinical

Molecular Formula: C27H24N2O4

Molecular Weight: 440.50

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(N(C(C)=O)c2cn(C(C)=O)c3ccccc23)c(C)cc1C(=O)c1ccccc1

Standard InChI:  InChI=1S/C27H24N2O4/c1-17-14-22(27(32)20-10-6-5-7-11-20)26(33-4)15-24(17)29(19(3)31)25-16-28(18(2)30)23-13-9-8-12-21(23)25/h5-16H,1-4H3

Standard InChI Key:  SGKCWIHBFSFXFR-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1855   -2.6254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3877   -3.5218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3606   -2.8684    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1812    2.6271    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6500    2.9355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6488    1.8163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1174    2.1217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5873    3.5462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5886    4.6654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1200    4.3600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1824    3.7473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5580    4.8870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0075    3.5032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1144    0.9998    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.7369   -0.1393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0561    3.8547    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5242    5.2806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8566    2.9607    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3211    5.2554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9917    5.5911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4567    7.0173    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4541    8.1330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9866    7.8226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5216    6.3965    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  7 10  1  0
 10 11  1  0
 10 12  2  0
  9 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 13 20  1  0
 20 21  2  0
 20 22  1  0
 16 23  1  0
 23 24  1  0
 17 25  1  0
 25 26  1  0
 25 27  2  0
 19 28  1  0
 26 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 26  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3809558

    ---

Associated Targets(Human)

BAZ2B Tchem Bromodomain adjacent to zinc finger domain protein 2B (56204 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 440.50Molecular Weight (Monoisotopic): 440.1736AlogP: 5.53#Rotatable Bonds: 5
Polar Surface Area: 68.61Molecular Species: NEUTRALHBA: 5HBD:
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: 3.97CX LogD: 3.97
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.38Np Likeness Score: -0.67

References

1. Unzue A, Zhao H, Lolli G, Dong J, Zhu J, Zechner M, Dolbois A, Caflisch A, Nevado C..  (2016)  The "Gatekeeper" Residue Influences the Mode of Binding of Acetyl Indoles to Bromodomains.,  59  (7): [PMID:26982797] [10.1021/acs.jmedchem.5b01757]

Source