The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[4-(1H-benzimidazol-2-yl)-phenyl]-[6-(4-trifluoromethylphenyl)-2-morpholin-4-yl-[1,3,5]triazin-2-yl]-amine ID: ALA3809585
PubChem CID: 127044432
Max Phase: Preclinical
Molecular Formula: C27H22F3N7O
Molecular Weight: 517.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: FC(F)(F)c1ccc(-c2nc(Nc3ccc(-c4nc5ccccc5[nH]4)cc3)nc(N3CCOCC3)n2)cc1
Standard InChI: InChI=1S/C27H22F3N7O/c28-27(29,30)19-9-5-17(6-10-19)24-34-25(36-26(35-24)37-13-15-38-16-14-37)31-20-11-7-18(8-12-20)23-32-21-3-1-2-4-22(21)33-23/h1-12H,13-16H2,(H,32,33)(H,31,34,35,36)
Standard InChI Key: HDVVTMWWROUPHD-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 43 0 0 0 0 0 0 0 0999 V2000
8.5716 0.4033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.4848 4.4773 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.3427 3.2468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.7060 1.8887 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.2114 1.7609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3536 2.9915 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.9903 4.3496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.8380 3.3746 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
13.4770 4.7317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.9717 4.8570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.8276 3.6252 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.1888 2.2681 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6940 2.1427 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1320 5.5807 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0761 0.2776 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4347 -1.0784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9397 -1.2009 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0896 0.0290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7275 1.3885 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2225 1.5111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6372 5.4555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7813 6.6873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4201 8.0445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9149 8.1698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7708 6.9380 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5638 9.2770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3679 9.1775 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
6.0752 10.3626 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.8795 10.2628 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
2 7 2 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
8 13 1 0
3 8 1 0
7 14 1 0
1 5 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
15 20 2 0
21 22 2 0
22 23 1 0
23 24 1 0
24 25 1 0
21 25 1 0
26 27 1 0
27 28 2 0
28 29 1 0
24 29 2 0
23 26 2 0
18 21 1 0
1 15 1 0
14 30 2 0
30 31 1 0
31 32 2 0
32 33 1 0
33 34 2 0
34 14 1 0
32 35 1 0
35 36 1 0
35 37 1 0
35 38 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 517.52Molecular Weight (Monoisotopic): 517.1838AlogP: 5.68#Rotatable Bonds: 5Polar Surface Area: 91.85Molecular Species: NEUTRALHBA: 7HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.54CX Basic pKa: 5.61CX LogP: 6.87CX LogD: 6.86Aromatic Rings: 5Heavy Atoms: 38QED Weighted: 0.31Np Likeness Score: -1.67
References 1. Singla P, Luxami V, Paul K.. (2016) Synthesis and in vitro evaluation of novel triazine analogues as anticancer agents and their interaction studies with bovine serum albumin., 117 [PMID:27089212 ] [10.1016/j.ejmech.2016.03.088 ]