The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-Benzyl-5-[3-(2,5-di(aziridin-1-yl)-3,6-dioxocyclohexa-1,4-dienyl)isoxazol-5-yl]-N-methylthiophene-2-carboxamide ID: ALA3809887
PubChem CID: 127045074
Max Phase: Preclinical
Molecular Formula: C26H22N4O4S
Molecular Weight: 486.55
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CN(Cc1ccccc1)C(=O)c1ccc(-c2cc(C3=C(N4CC4)C(=O)C=C(N4CC4)C3=O)no2)s1
Standard InChI: InChI=1S/C26H22N4O4S/c1-28(15-16-5-3-2-4-6-16)26(33)22-8-7-21(35-22)20-13-17(27-34-20)23-24(30-11-12-30)19(31)14-18(25(23)32)29-9-10-29/h2-8,13-14H,9-12,15H2,1H3
Standard InChI Key: WLKDFJCSTTVCJY-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 40 0 0 0 0 0 0 0 0999 V2000
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9511 -0.8815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9530 -1.9978 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2010 -3.2957 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.7343 -2.9815 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.4458 -1.8433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.2720 -0.6124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.7097 -1.0404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.7469 -2.5399 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.3323 -3.0387 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-9.9787 -3.3928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.8568 -4.8886 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-11.0634 -2.8795 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-8.7721 -5.4019 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.0907 -5.7429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 2.7000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -2.7000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5987 1.5004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 -1.5004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.2716 2.7526 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0195 1.4524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0197 -1.4569 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2676 -2.7548 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.9688 -7.2388 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.2009 -8.0945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-12.0759 -9.5893 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.7190 -10.2285 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.4869 -9.3729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.6118 -7.8781 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 1 0
4 5 2 0
5 6 1 0
6 1 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 1 0
11 7 2 0
5 7 1 0
9 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
16 12 1 0
15 17 1 0
17 18 1 0
17 19 2 0
18 20 1 0
18 21 1 0
3 22 2 0
6 23 2 0
4 24 1 0
1 25 1 0
26 24 1 0
27 26 1 0
24 27 1 0
28 25 1 0
29 28 1 0
25 29 1 0
21 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 30 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 486.55Molecular Weight (Monoisotopic): 486.1362AlogP: 3.05#Rotatable Bonds: 7Polar Surface Area: 86.50Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 2.92CX LogD: 2.92Aromatic Rings: 3Heavy Atoms: 35QED Weighted: 0.37Np Likeness Score: -1.09
References 1. Swapnaja KJ, Yennam S, Chavali M, Poornachandra Y, Kumar CG, Muthusamy K, Jayaraman VB, Arumugam P, Balasubramanian S, Sriram KK.. (2016) Design, synthesis and biological evaluation of diaziridinyl quinone isoxazole hybrids., 117 [PMID:27089214 ] [10.1016/j.ejmech.2016.03.042 ]