The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(1-acetyl-1H-indol-3-yl)-N-(5-hydroxy-2-methylphenyl)-3-(trifluoromethyl)benzamide ID: ALA3809983
PubChem CID: 91971269
Max Phase: Preclinical
Molecular Formula: C25H19F3N2O3
Molecular Weight: 452.43
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(=O)n1cc(N(C(=O)c2cccc(C(F)(F)F)c2)c2cc(O)ccc2C)c2ccccc21
Standard InChI: InChI=1S/C25H19F3N2O3/c1-15-10-11-19(32)13-22(15)30(24(33)17-6-5-7-18(12-17)25(26,27)28)23-14-29(16(2)31)21-9-4-3-8-20(21)23/h3-14,32H,1-2H3
Standard InChI Key: GRQZQCNAGDASPY-UHFFFAOYSA-N
Molfile:
RDKit 2D
33 36 0 0 0 0 0 0 0 0999 V2000
3.6490 2.9355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6510 1.8181 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1195 2.1239 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1186 1.0050 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6493 -0.4196 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1808 -0.7255 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1816 0.3933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0226 4.0759 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.1802 2.6274 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5879 1.3111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1782 3.7448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2903 3.4390 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2894 4.5579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8201 5.9825 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6484 6.2884 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6475 5.1696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6659 2.2993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0239 7.4281 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1855 -2.6254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3606 -2.8684 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3877 -3.5218 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9641 2.4506 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.3869 0.4157 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.7628 1.5552 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
2 7 2 0
1 8 2 0
1 9 1 0
4 10 1 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
11 16 2 0
12 17 1 0
15 18 1 0
9 11 1 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 27 1 0
19 27 1 0
22 27 2 0
28 29 2 0
28 30 1 0
19 28 1 0
9 21 1 0
10 31 1 0
10 32 1 0
10 33 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.43Molecular Weight (Monoisotopic): 452.1348AlogP: 6.31#Rotatable Bonds: 3Polar Surface Area: 62.54Molecular Species: NEUTRALHBA: 4HBD: 1#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 9.54CX Basic pKa: ┄CX LogP: 5.09CX LogD: 5.09Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.40Np Likeness Score: -0.93
References 1. Unzue A, Zhao H, Lolli G, Dong J, Zhu J, Zechner M, Dolbois A, Caflisch A, Nevado C.. (2016) The "Gatekeeper" Residue Influences the Mode of Binding of Acetyl Indoles to Bromodomains., 59 (7): [PMID:26982797 ] [10.1021/acs.jmedchem.5b01757 ]