N-(1-acetyl-1H-indol-3-yl)-N-(5-hydroxy-2-methylphenyl)-3-(trifluoromethyl)benzamide

ID: ALA3809983

PubChem CID: 91971269

Max Phase: Preclinical

Molecular Formula: C25H19F3N2O3

Molecular Weight: 452.43

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC(=O)n1cc(N(C(=O)c2cccc(C(F)(F)F)c2)c2cc(O)ccc2C)c2ccccc21

Standard InChI:  InChI=1S/C25H19F3N2O3/c1-15-10-11-19(32)13-22(15)30(24(33)17-6-5-7-18(12-17)25(26,27)28)23-14-29(16(2)31)21-9-4-3-8-20(21)23/h3-14,32H,1-2H3

Standard InChI Key:  GRQZQCNAGDASPY-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 36  0  0  0  0  0  0  0  0999 V2000
    3.6490    2.9355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6510    1.8181    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1195    2.1239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1186    1.0050    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6493   -0.4196    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1808   -0.7255    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1816    0.3933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0226    4.0759    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1802    2.6274    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.5879    1.3111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1782    3.7448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2903    3.4390    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2894    4.5579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8201    5.9825    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6484    6.2884    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6475    5.1696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6659    2.2993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0239    7.4281    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1855   -2.6254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3606   -2.8684    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3877   -3.5218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9641    2.4506    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.3869    0.4157    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.7628    1.5552    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  2  7  2  0
  1  8  2  0
  1  9  1  0
  4 10  1  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 11 16  2  0
 12 17  1  0
 15 18  1  0
  9 11  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 19 27  1  0
 22 27  2  0
 28 29  2  0
 28 30  1  0
 19 28  1  0
  9 21  1  0
 10 31  1  0
 10 32  1  0
 10 33  1  0
M  END

Associated Targets(Human)

BAZ2B Tchem Bromodomain adjacent to zinc finger domain protein 2B (56204 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 452.43Molecular Weight (Monoisotopic): 452.1348AlogP: 6.31#Rotatable Bonds: 3
Polar Surface Area: 62.54Molecular Species: NEUTRALHBA: 4HBD: 1
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 1#RO5 Violations (Lipinski): 1
CX Acidic pKa: 9.54CX Basic pKa: CX LogP: 5.09CX LogD: 5.09
Aromatic Rings: 4Heavy Atoms: 33QED Weighted: 0.40Np Likeness Score: -0.93

References

1. Unzue A, Zhao H, Lolli G, Dong J, Zhu J, Zechner M, Dolbois A, Caflisch A, Nevado C..  (2016)  The "Gatekeeper" Residue Influences the Mode of Binding of Acetyl Indoles to Bromodomains.,  59  (7): [PMID:26982797] [10.1021/acs.jmedchem.5b01757]

Source