The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
Plakinic acid M ID: ALA3809994
PubChem CID: 127043574
Max Phase: Preclinical
Molecular Formula: C26H42O4
Molecular Weight: 418.62
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C[C@H](CCCCCCCCCc1ccccc1)C[C@]1(C)C[C@H](C)[C@H](CC(=O)O)OO1
Standard InChI: InChI=1S/C26H42O4/c1-21(19-26(3)20-22(2)24(29-30-26)18-25(27)28)14-10-7-5-4-6-8-11-15-23-16-12-9-13-17-23/h9,12-13,16-17,21-22,24H,4-8,10-11,14-15,18-20H2,1-3H3,(H,27,28)/t21-,22+,24+,26-/m1/s1
Standard InChI Key: GMTBZACDABXTKT-CDTXBXJGSA-N
Molfile:
RDKit 2D
30 31 0 0 0 0 0 0 0 0999 V2000
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3383 -1.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5973 1.5031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5951 3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.5549 3.6021 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6331 3.6060 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2696 -1.9496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5625 0.0216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5631 1.5224 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8627 2.2731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8634 3.7739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1630 4.5246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1636 6.0254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5240 2.1225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4632 6.7761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4638 8.2769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7634 9.0276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7640 10.5284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0636 11.2791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0643 12.7800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3621 13.5321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.3597 15.0321 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0594 15.7800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7616 15.0280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7640 13.5280 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
5 7 1 6
4 8 1 6
8 9 1 0
9 10 1 0
9 11 2 0
1 12 1 1
1 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
14 19 1 6
18 20 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
29 30 2 0
30 25 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 418.62Molecular Weight (Monoisotopic): 418.3083AlogP: 6.97#Rotatable Bonds: 14Polar Surface Area: 55.76Molecular Species: ACIDHBA: 3HBD: 1#RO5 Violations: 1HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 1CX Acidic pKa: 4.52CX Basic pKa: ┄CX LogP: 7.94CX LogD: 5.15Aromatic Rings: 1Heavy Atoms: 30QED Weighted: 0.26Np Likeness Score: 1.66
References 1. Jamison MT, Dalisay DS, Molinski TF.. (2016) Peroxide Natural Products from Plakortis zyggompha and the Sponge Association Plakortis halichondrioides-Xestospongia deweerdtae: Antifungal Activity against Cryptococcus gattii., 79 (3): [PMID:26859086 ] [10.1021/acs.jnatprod.5b00951 ]