The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3,5-bis(trifluoromethyl)phenyl)-1-(3-chlorobenzoyl)-1,2,3,4-tetrahydroquinoline-2-carboxamide ID: ALA3810024
PubChem CID: 127045183
Max Phase: Preclinical
Molecular Formula: C25H17ClF6N2O2
Molecular Weight: 526.86
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C1CCc2ccccc2N1C(=O)c1cccc(Cl)c1
Standard InChI: InChI=1S/C25H17ClF6N2O2/c26-18-6-3-5-15(10-18)23(36)34-20-7-2-1-4-14(20)8-9-21(34)22(35)33-19-12-16(24(27,28)29)11-17(13-19)25(30,31)32/h1-7,10-13,21H,8-9H2,(H,33,35)
Standard InChI Key: MESYBFOOHVFJFG-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 39 0 0 0 0 0 0 0 0999 V2000
-1.2964 1.4973 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6111 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 -1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 -0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5929 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2964 1.4973 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.7486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9122 1.4966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9138 2.4966 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2109 0.7445 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2907 2.9981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5870 3.7544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2489 3.5938 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.5121 1.4924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8113 0.7426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1103 1.4927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1101 2.9927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8110 3.7426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5121 2.9924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8109 5.2434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8496 5.8442 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-6.7714 5.8430 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-7.8102 6.4434 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-10.4101 0.7424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.4110 -0.4576 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-11.4491 1.3429 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-11.4497 0.1430 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.5835 5.2544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8807 6.0076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1815 5.2608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1852 3.7608 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8880 3.0076 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.0524 3.2629 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 10 1 0
1 10 1 0
5 10 2 0
11 12 2 0
11 13 1 0
2 11 1 0
14 15 1 0
14 16 2 0
1 14 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
17 22 2 0
13 17 1 0
23 24 1 0
23 25 1 0
23 26 1 0
21 23 1 0
27 28 1 0
27 29 1 0
27 30 1 0
19 27 1 0
15 31 2 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 15 1 0
34 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 526.86Molecular Weight (Monoisotopic): 526.0883AlogP: 6.98#Rotatable Bonds: 3Polar Surface Area: 49.41Molecular Species: NEUTRALHBA: 2HBD: 1#RO5 Violations: 2HBA (Lipinski): 4HBD (Lipinski): 1#RO5 Violations (Lipinski): 2CX Acidic pKa: 11.61CX Basic pKa: ┄CX LogP: 6.90CX LogD: 6.90Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.37Np Likeness Score: -1.42
References 1. Jo H, Choi M, Kumar AS, Jung Y, Kim S, Yun J, Kang JS, Kim Y, Han SB, Jung JK, Cho J, Lee K, Kwak JH, Lee H.. (2016) Development of Novel 1,2,3,4-Tetrahydroquinoline Scaffolds as Potent NF-κB Inhibitors and Cytotoxic Agents., 7 (4): [PMID:27096046 ] [10.1021/acsmedchemlett.6b00004 ]