The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-(2-((2-(5-Fluoro-2-methoxyphenoxy)ethyl)amino)propyl)-1-(3-hydroxypropyl)-1H-indole-7-carboxamide ID: ALA3810110
PubChem CID: 123562321
Max Phase: Preclinical
Molecular Formula: C24H30FN3O4
Molecular Weight: 443.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(F)cc1OCCNC(C)Cc1cc(C(N)=O)c2c(ccn2CCCO)c1
Standard InChI: InChI=1S/C24H30FN3O4/c1-16(27-7-11-32-22-15-19(25)4-5-21(22)31-2)12-17-13-18-6-9-28(8-3-10-29)23(18)20(14-17)24(26)30/h4-6,9,13-16,27,29H,3,7-8,10-12H2,1-2H3,(H2,26,30)
Standard InChI Key: ZPZSLCYMUPFPPB-UHFFFAOYSA-N
Molfile:
RDKit 2D
32 34 0 0 0 0 0 0 0 0999 V2000
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6187 1.4919 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6267 2.9927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9300 3.7369 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5905 3.5979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9380 5.2378 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2413 5.9820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2494 7.4828 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.5527 8.2271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8467 7.4683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.1508 8.2095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.1609 9.7095 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-8.8670 10.4683 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.5629 9.7271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1855 -2.6254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6552 -2.9294 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1277 -4.3539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3028 -4.5970 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.9971 -3.0138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0337 -3.6184 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0446 -3.6095 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-6.2698 10.4890 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.2797 11.6889 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.1859 7.6025 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 6 2 0
5 4 2 0
4 1 1 0
5 6 1 0
6 7 1 0
7 8 1 0
8 9 2 0
9 5 1 0
1 10 1 0
10 11 1 0
11 12 1 0
11 13 1 0
12 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 17 1 0
7 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
3 27 1 0
27 28 2 0
27 29 1 0
22 30 1 0
30 31 1 0
19 32 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 443.52Molecular Weight (Monoisotopic): 443.2220AlogP: 2.87#Rotatable Bonds: 12Polar Surface Area: 98.74Molecular Species: BASEHBA: 6HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 9.52CX LogP: 2.41CX LogD: 0.31Aromatic Rings: 3Heavy Atoms: 32QED Weighted: 0.37Np Likeness Score: -0.83
References 1. Zhao F, Li J, Chen Y, Tian Y, Wu C, Xie Y, Zhou Y, Wang J, Xie X, Liu H.. (2016) Design, Synthesis, and Biological Evaluation of Indoline and Indole Derivatives as Potent and Selective α1A-Adrenoceptor Antagonists., 59 (8): [PMID:27031406 ] [10.1021/acs.jmedchem.5b02023 ]