2-((3S,5R)-3,5-Diethyl-5-pentyltetrahydrofuran-2-yl)-2-hydroxyacetic acid

ID: ALA3810293

PubChem CID: 127043555

Max Phase: Preclinical

Molecular Formula: C15H28O4

Molecular Weight: 272.39

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCCCC[C@]1(CC)C[C@H](CC)[C@@H]([C@H](O)C(=O)O)O1

Standard InChI:  InChI=1S/C15H28O4/c1-4-7-8-9-15(6-3)10-11(5-2)13(19-15)12(16)14(17)18/h11-13,16H,4-10H2,1-3H3,(H,17,18)/t11-,12-,13-,15+/m0/s1

Standard InChI Key:  AMFPUNUKBPDKTB-PWNZVWSESA-N

Molfile:  

     RDKit          2D

 20 20  0  0  0  0  0  0  0  0999 V2000
    0.7500   -1.0323    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2135    0.3943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.2760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2135    0.3943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7500   -1.0323    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1233   -2.3813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3692   -2.5388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9800   -3.9097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4725   -4.0672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9609   -5.1634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2270   -0.8533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9331   -1.8236    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0031    2.7742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4997    1.8540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6077    2.6566    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9268    2.3187    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8188    1.5160    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1763    3.4924    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9461   -0.2864    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0345    3.3770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  5 11  1  1
 11 12  1  0
  3 13  1  6
  2 14  1  0
 14 15  1  6
 14 16  1  0
 16 17  1  0
 16 18  2  0
  2 19  1  6
 13 20  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3810293

    ---

Associated Targets(non-human)

Pichia kudriavzevii (7448 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Cryptococcus bacillisporus (1003 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Candida albicans (78123 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 272.39Molecular Weight (Monoisotopic): 272.1988AlogP: 2.98#Rotatable Bonds: 8
Polar Surface Area: 66.76Molecular Species: ACIDHBA: 3HBD: 2
#RO5 Violations: HBA (Lipinski): 4HBD (Lipinski): 2#RO5 Violations (Lipinski):
CX Acidic pKa: 4.18CX Basic pKa: CX LogP: 3.48CX LogD: 0.43
Aromatic Rings: Heavy Atoms: 19QED Weighted: 0.67Np Likeness Score: 1.65

References

1. Jamison MT, Dalisay DS, Molinski TF..  (2016)  Peroxide Natural Products from Plakortis zyggompha and the Sponge Association Plakortis halichondrioides-Xestospongia deweerdtae: Antifungal Activity against Cryptococcus gattii.,  79  (3): [PMID:26859086] [10.1021/acs.jnatprod.5b00951]

Source