N-(1-Acetyl-1H-indol-3-yl)-N-(2-methoxyphenyl)acetamide

ID: ALA3810307

PubChem CID: 127045561

Max Phase: Preclinical

Molecular Formula: C19H18N2O3

Molecular Weight: 322.36

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccccc1N(C(C)=O)c1cn(C(C)=O)c2ccccc12

Standard InChI:  InChI=1S/C19H18N2O3/c1-13(22)20-12-18(15-8-4-5-9-16(15)20)21(14(2)23)17-10-6-7-11-19(17)24-3/h4-12H,1-3H3

Standard InChI Key:  IOOGACUYRKTWMB-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 24 26  0  0  0  0  0  0  0  0999 V2000
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1855   -2.6254    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3877   -3.5218    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3606   -2.8684    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1812    2.6271    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6500    2.9355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6488    1.8163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1174    2.1217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5873    3.5462    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5886    4.6654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1200    4.3600    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1824    3.7473    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5580    4.8870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0075    3.5032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1231    5.4819    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5006    6.6210    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  6  2  0
  5  4  2  0
  4  1  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9  5  1  0
  7 10  1  0
 10 11  1  0
 10 12  2  0
  9 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 14  1  0
 13 20  1  0
 20 21  2  0
 20 22  1  0
 19 23  1  0
 23 24  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3810307

    ---

Associated Targets(Human)

BAZ2B Tchem Bromodomain adjacent to zinc finger domain protein 2B (56204 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 322.36Molecular Weight (Monoisotopic): 322.1317AlogP: 3.99#Rotatable Bonds: 3
Polar Surface Area: 51.54Molecular Species: NEUTRALHBA: 4HBD:
#RO5 Violations: HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 1.99CX LogD: 1.99
Aromatic Rings: 3Heavy Atoms: 24QED Weighted: 0.73Np Likeness Score: -0.81

References

1. Unzue A, Zhao H, Lolli G, Dong J, Zhu J, Zechner M, Dolbois A, Caflisch A, Nevado C..  (2016)  The "Gatekeeper" Residue Influences the Mode of Binding of Acetyl Indoles to Bromodomains.,  59  (7): [PMID:26982797] [10.1021/acs.jmedchem.5b01757]

Source