2-ethyl-5,7-dimethyl-3-(naphthalen-2-ylmethyl)-3H-imidazo[4,5-b]pyridine

ID: ALA3810343

PubChem CID: 127043395

Max Phase: Preclinical

Molecular Formula: C21H21N3

Molecular Weight: 315.42

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CCc1nc2c(C)cc(C)nc2n1Cc1ccc2ccccc2c1

Standard InChI:  InChI=1S/C21H21N3/c1-4-19-23-20-14(2)11-15(3)22-21(20)24(19)13-16-9-10-17-7-5-6-8-18(17)12-16/h5-12H,4,13H2,1-3H3

Standard InChI Key:  NYHKKKJCGBYJBD-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 24 27  0  0  0  0  0  0  0  0999 V2000
   -3.9091    1.5019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9067    3.0027    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1539    5.2699    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7042    3.8361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6472    5.2811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1142    3.8609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5831    3.5378    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5909    4.6753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1240    6.0955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6378    6.4129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2594    7.5517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.7661    4.4325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2885    3.3453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3806    4.1300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964   -1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964   -1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
 15  1  1  0
  1  2  1  0
  2  6  1  0
  5  3  1  0
  3  4  2  0
  4  2  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
 10  5  1  0
 10 11  1  0
  8 12  1  0
  4 13  1  0
 13 14  1  0
 15 16  2  0
 16 17  1  0
 17 20  2  0
 19 18  2  0
 18 15  1  0
 19 20  1  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 23 24  2  0
 24 19  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3810343

    ---

Associated Targets(Human)

GPR4 Tchem G-protein coupled receptor 4 (124 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 315.42Molecular Weight (Monoisotopic): 315.1735AlogP: 4.81#Rotatable Bonds: 3
Polar Surface Area: 30.71Molecular Species: NEUTRALHBA: 3HBD:
#RO5 Violations: HBA (Lipinski): 3HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: 3.45CX LogP: 4.82CX LogD: 4.82
Aromatic Rings: 4Heavy Atoms: 24QED Weighted: 0.54Np Likeness Score: -1.49

References

1. Fukuda H, Ito S, Watari K, Mogi C, Arisawa M, Okajima F, Kurose H, Shuto S..  (2016)  Identification of a Potent and Selective GPR4 Antagonist as a Drug Lead for the Treatment of Myocardial Infarction.,  (5): [PMID:27190599] [10.1021/acsmedchemlett.6b00014]

Source