The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1,12-Bis(N-butylpyrrolidinium)dodecane dichloride ID: ALA381324
PubChem CID: 11648897
Max Phase: Preclinical
Molecular Formula: C28H58Cl2N2
Molecular Weight: 422.79
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: 1,12-Bis(N-Butylpyrrolidinium)Dodecane Dichloride | CHEMBL381324|1,12-Bis(N-butylpyrrolidinium)dodecane dichloride
Canonical SMILES: CCCC[N+]1(CCCCCCCCCCCC[N+]2(CCCC)CCCC2)CCCC1.[Cl-].[Cl-]
Standard InChI: InChI=1S/C28H58N2.2ClH/c1-3-5-21-29(25-17-18-26-29)23-15-13-11-9-7-8-10-12-14-16-24-30(22-6-4-2)27-19-20-28-30;;/h3-28H2,1-2H3;2*1H/q+2;;/p-2
Standard InChI Key: JRASMCWSOMBRTQ-UHFFFAOYSA-L
Molfile:
RDKit 2D
32 31 0 0 0 0 0 0 0 0999 V2000
5.2623 -4.4217 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
5.9564 -3.0580 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.6690 -2.6423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4942 -1.8360 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6713 -1.7509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3400 -2.5111 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3254 -3.4991 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6128 -3.0880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.9002 -3.4945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1831 -3.0834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4705 -3.4899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2421 -3.0788 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9547 -3.4899 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6719 -3.0743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3845 -3.4854 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0971 -3.0697 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8097 -3.4808 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5223 -3.0651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2395 -3.4762 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.5818 -2.7131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4067 -2.7118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.6595 -3.4922 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9941 -3.9780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9189 -4.2162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5368 -3.6452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3326 -4.9296 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9194 -5.6458 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3375 -6.3590 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3163 -4.4446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8975 -5.0326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.6817 -5.8273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4028 -4.3852 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
7 8 1 0
16 17 1 0
2 3 1 0
17 18 1 0
8 9 1 0
18 19 1 0
19 2 1 0
7 20 1 0
9 10 1 0
3 4 1 0
10 11 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 7 1 0
4 5 1 0
7 24 1 0
11 12 1 0
2 25 1 0
5 6 1 0
24 26 1 0
12 13 1 0
26 27 1 0
6 2 1 0
27 28 1 0
13 14 1 0
25 29 1 0
29 30 1 0
14 15 1 0
30 31 1 0
15 16 1 0
M CHG 4 1 -1 2 1 7 1 32 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 422.79Molecular Weight (Monoisotopic): 422.4589AlogP: 7.71#Rotatable Bonds: 19Polar Surface Area: 0.00Molecular Species: ┄HBA: ┄HBD: ┄#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: -0.52CX LogD: -0.52Aromatic Rings: ┄Heavy Atoms: 30QED Weighted: 0.15Np Likeness Score: 0.11
References 1. Ng CK, Obando D, Widmer F, Wright LC, Sorrell TC, Jolliffe KA.. (2006) Correlation of antifungal activity with fungal phospholipase inhibition using a series of bisquaternary ammonium salts., 49 (2): [PMID:16420066 ] [10.1021/jm0508843 ]