1,12-Bis(N-butylpyrrolidinium)dodecane dichloride

ID: ALA381324

PubChem CID: 11648897

Max Phase: Preclinical

Molecular Formula: C28H58Cl2N2

Molecular Weight: 422.79

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Synonyms: 1,12-Bis(N-Butylpyrrolidinium)Dodecane Dichloride | CHEMBL381324|1,12-Bis(N-butylpyrrolidinium)dodecane dichloride

Canonical SMILES:  CCCC[N+]1(CCCCCCCCCCCC[N+]2(CCCC)CCCC2)CCCC1.[Cl-].[Cl-]

Standard InChI:  InChI=1S/C28H58N2.2ClH/c1-3-5-21-29(25-17-18-26-29)23-15-13-11-9-7-8-10-12-14-16-24-30(22-6-4-2)27-19-20-28-30;;/h3-28H2,1-2H3;2*1H/q+2;;/p-2

Standard InChI Key:  JRASMCWSOMBRTQ-UHFFFAOYSA-L

Molfile:  

     RDKit          2D

 32 31  0  0  0  0  0  0  0  0999 V2000
    5.2623   -4.4217    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    5.9564   -3.0580    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6690   -2.6423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4942   -1.8360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6713   -1.7509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3400   -2.5111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3254   -3.4991    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6128   -3.0880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9002   -3.4945    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1831   -3.0834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4705   -3.4899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2421   -3.0788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9547   -3.4899    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6719   -3.0743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3845   -3.4854    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0971   -3.0697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8097   -3.4808    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5223   -3.0651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2395   -3.4762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5818   -2.7131    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4067   -2.7118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6595   -3.4922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9941   -3.9780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9189   -4.2162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5368   -3.6452    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3326   -4.9296    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9194   -5.6458    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3375   -6.3590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3163   -4.4446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8975   -5.0326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6817   -5.8273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4028   -4.3852    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  7  8  1  0
 16 17  1  0
  2  3  1  0
 17 18  1  0
  8  9  1  0
 18 19  1  0
 19  2  1  0
  7 20  1  0
  9 10  1  0
  3  4  1  0
 10 11  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23  7  1  0
  4  5  1  0
  7 24  1  0
 11 12  1  0
  2 25  1  0
  5  6  1  0
 24 26  1  0
 12 13  1  0
 26 27  1  0
  6  2  1  0
 27 28  1  0
 13 14  1  0
 25 29  1  0
 29 30  1  0
 14 15  1  0
 30 31  1  0
 15 16  1  0
M  CHG  4   1  -1   2   1   7   1  32  -1
M  END

Associated Targets(non-human)

Cryptococcus neoformans (21258 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Candida albicans (78123 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PLB1 Phospholipase B (44 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 422.79Molecular Weight (Monoisotopic): 422.4589AlogP: 7.71#Rotatable Bonds: 19
Polar Surface Area: 0.00Molecular Species: HBA: HBD:
#RO5 Violations: 1HBA (Lipinski): 2HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: CX LogP: -0.52CX LogD: -0.52
Aromatic Rings: Heavy Atoms: 30QED Weighted: 0.15Np Likeness Score: 0.11

References

1. Ng CK, Obando D, Widmer F, Wright LC, Sorrell TC, Jolliffe KA..  (2006)  Correlation of antifungal activity with fungal phospholipase inhibition using a series of bisquaternary ammonium salts.,  49  (2): [PMID:16420066] [10.1021/jm0508843]

Source