(S,E)-ethyl 4-((2S,4R)-4-benzyl-1-((S)-3-methyl-2-(5-methylisoxazole-3-carboxamido)butanoyl)pyrrolidine-2-carboxamido)-5-((S)-2-oxopyrrolidin-3-yl)pent-2-enoate

ID: ALA3813740

PubChem CID: 127049319

Max Phase: Preclinical

Molecular Formula: C33H43N5O7

Molecular Weight: 621.74

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  CCOC(=O)/C=C/[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@@H]1C[C@@H](Cc2ccccc2)CN1C(=O)[C@@H](NC(=O)c1cc(C)on1)C(C)C

Standard InChI:  InChI=1S/C33H43N5O7/c1-5-44-28(39)12-11-25(18-24-13-14-34-30(24)40)35-32(42)27-17-23(16-22-9-7-6-8-10-22)19-38(27)33(43)29(20(2)3)36-31(41)26-15-21(4)45-37-26/h6-12,15,20,23-25,27,29H,5,13-14,16-19H2,1-4H3,(H,34,40)(H,35,42)(H,36,41)/b12-11+/t23-,24+,25-,27+,29+/m1/s1

Standard InChI Key:  KFHXWTPLVGYQTM-NBLOEBRGSA-N

Molfile:  

     RDKit          2D

 46 49  0  0  0  0  0  0  0  0999 V2000
   -3.8116   -8.5851    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9227   -7.3758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4309   -7.5400    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4050   -6.2770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5420   -6.3307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9498   -6.4949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1424   -4.9552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4307   -3.9891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3350   -4.8215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8372   -5.2877    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.4322   -7.5937    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3786   -3.8595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8056   -3.8679    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3372   -5.2929    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2111   -6.5099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5939   -7.8779    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4051   -6.3907    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.4694   -9.0970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9631   -8.9509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8522  -10.4651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8372  -10.1710    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3309  -10.0249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2050  -11.2449    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.8266   -8.9321    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6987  -11.0989    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3976  -12.0744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7276  -11.6841    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6619  -12.8106    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0355  -12.2079    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8868  -10.7153    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4212  -10.3955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0034   -9.4870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2987   -8.5622    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7672   -9.9872    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5567  -10.8731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3401   -9.9956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5609  -12.0731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3160  -12.5955    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  0
  3  5  1  0
  5  6  1  0
  5  7  1  1
  7  8  1  0
  7  9  1  0
  6 10  1  0
  6 11  2  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 10  1  0
 15 16  1  1
 16 17  1  0
 16 18  2  0
 17 19  1  0
 19 20  1  0
 19 21  1  6
 20 22  2  0
 22 23  1  0
 23 24  1  0
 23 25  2  0
 24 26  1  0
 26 27  1  0
 21 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 28  1  0
 32 33  2  0
  1 34  2  0
 34 35  1  0
 35 36  1  0
 36 37  2  0
 37  1  1  0
 36 38  1  0
 28 39  1  6
 41 40  1  0
 13 40  1  6
 41 42  2  0
 42 43  1  0
 43 44  2  0
 44 45  1  0
 45 46  2  0
 46 41  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3813740

    ---

Associated Targets(non-human)

rhinovirus A2 (409 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
rhinovirus A16 (69 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 621.74Molecular Weight (Monoisotopic): 621.3162AlogP: 2.33#Rotatable Bonds: 13
Polar Surface Area: 159.94Molecular Species: NEUTRALHBA: 8HBD: 3
#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 12.47CX Basic pKa: CX LogP: 2.47CX LogD: 2.47
Aromatic Rings: 2Heavy Atoms: 45QED Weighted: 0.23Np Likeness Score: -0.23

References

1. Kawatkar SP, Gagnon M, Hoesch V, Tiong-Yip C, Johnson K, Ek M, Nilsson E, Lister T, Olsson L, Patel J, Yu Q..  (2016)  Design and structure-activity relationships of novel inhibitors of human rhinovirus 3C protease.,  26  (14): [PMID:27265257] [10.1016/j.bmcl.2016.05.066]

Source