The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
O-(Hydroxy(((2R,3S)-2-(((3-(2-((3-phenoxybenzyl)oxy)phenyl)-propanoyl)oxy)methyl)tetrahydro-2H-pyran-3-yl)oxy)phosphoryl)-L-serine ID: ALA3813773
PubChem CID: 78319776
Max Phase: Preclinical
Molecular Formula: C31H36NO11P
Molecular Weight: 629.60
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N[C@@H](COP(=O)(O)O[C@H]1CCCO[C@@H]1COC(=O)CCc1ccccc1OCc1cccc(Oc2ccccc2)c1)C(=O)O
Standard InChI: InChI=1S/C31H36NO11P/c32-26(31(34)35)20-41-44(36,37)43-28-14-7-17-38-29(28)21-40-30(33)16-15-23-9-4-5-13-27(23)39-19-22-8-6-12-25(18-22)42-24-10-2-1-3-11-24/h1-6,8-13,18,26,28-29H,7,14-17,19-21,32H2,(H,34,35)(H,36,37)/t26-,28-,29+/m0/s1
Standard InChI Key: BIGHQMOUQYMHQN-PIZZNKLWSA-N
Molfile:
RDKit 2D
44 47 0 0 0 0 0 0 0 0999 V2000
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 -1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6044 -2.9986 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.6003 1.4978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8990 0.7455 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
5.2003 1.4932 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.8969 -0.4545 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8588 0.1471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.4990 0.7410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8003 1.4887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0990 0.7365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0969 -0.4635 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.1394 1.3343 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.8024 2.6887 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9057 -3.7463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9435 -3.1438 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9097 -5.2471 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2110 -5.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2150 -7.4957 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5146 -8.2449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5155 -9.7449 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2170 -10.4958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9175 -9.7466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9165 -8.2466 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8154 -7.4964 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1145 -8.2478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4154 -7.4993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7149 -8.2484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0135 -7.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.0126 -5.9977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.7131 -5.2484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4146 -5.9992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.3153 -8.2446 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
15.6135 -7.4916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9156 -8.2363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2116 -7.4810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2055 -5.9810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.9035 -5.2363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6075 -5.9915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 6 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 1 0
1 7 1 1
7 8 1 0
2 9 1 6
9 10 1 0
10 11 1 0
10 12 2 0
10 13 1 0
11 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
16 18 2 0
15 19 1 6
8 20 1 0
20 21 2 0
20 22 1 0
22 23 1 0
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
25 30 1 0
30 31 1 0
31 32 1 0
32 33 2 0
33 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 32 1 0
34 38 1 0
38 39 1 0
39 40 2 0
40 41 1 0
41 42 2 0
42 43 1 0
43 44 2 0
44 39 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 629.60Molecular Weight (Monoisotopic): 629.2026AlogP: 4.63#Rotatable Bonds: 16Polar Surface Area: 173.07Molecular Species: ZWITTERIONHBA: 10HBD: 3#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 1.49CX Basic pKa: 9.38CX LogP: 2.59CX LogD: -0.43Aromatic Rings: 3Heavy Atoms: 44QED Weighted: 0.15Np Likeness Score: 0.22
References 1. Jung S, Inoue A, Nakamura S, Kishi T, Uwamizu A, Sayama M, Ikubo M, Otani Y, Kano K, Makide K, Aoki J, Ohwada T.. (2016) Conformational Constraint of the Glycerol Moiety of Lysophosphatidylserine Affords Compounds with Receptor Subtype Selectivity., 59 (8): [PMID:27077565 ] [10.1021/acs.jmedchem.5b01925 ]