The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S,E)-ethyl 4-((2S,5S)-1-((S)-3-methyl-2-(5-methylisoxazole-3-carboxamido)butanoyl)-5-phenylpyrrolidine-2-carboxamido)-5-((S)-2-oxopyrrolidin-3-yl)pent-2-enoate ID: ALA3813781
PubChem CID: 127049009
Max Phase: Preclinical
Molecular Formula: C32H41N5O7
Molecular Weight: 607.71
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)/C=C/[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@@H]1CC[C@@H](c2ccccc2)N1C(=O)[C@@H](NC(=O)c1cc(C)on1)C(C)C
Standard InChI: InChI=1S/C32H41N5O7/c1-5-43-27(38)14-11-23(18-22-15-16-33-29(22)39)34-31(41)26-13-12-25(21-9-7-6-8-10-21)37(26)32(42)28(19(2)3)35-30(40)24-17-20(4)44-36-24/h6-11,14,17,19,22-23,25-26,28H,5,12-13,15-16,18H2,1-4H3,(H,33,39)(H,34,41)(H,35,40)/b14-11+/t22-,23+,25-,26-,28-/m0/s1
Standard InChI Key: SRAVKBAIVXTBKH-HMFOHWCYSA-N
Molfile:
RDKit 2D
45 48 0 0 0 0 0 0 0 0999 V2000
9.9899 4.5297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1998 3.2537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9089 1.9310 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0004 3.2912 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.1187 0.6550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8278 -0.6677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6185 0.6987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9879 -0.3222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0494 1.7552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.0391 -1.9415 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.0273 -0.7051 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.0319 -3.0489 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.3162 -4.3527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8460 -4.0550 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6748 -2.5648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3716 -1.8256 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3592 -0.3248 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.3372 -2.4338 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0538 0.4156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7584 -0.3424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0415 1.9165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4538 0.3995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1585 -0.3585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1461 0.3834 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1660 -1.5585 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.4414 -0.3746 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4845 0.2186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7361 2.6570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4159 3.2887 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4209 2.1662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1809 0.8731 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.6457 1.1963 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4055 0.5462 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4741 4.6249 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
11.8281 6.0825 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.5512 6.8696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.4081 5.8985 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.4602 8.0662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.7282 3.6570 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
11.5231 -2.8800 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1221 -1.5048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.6126 -1.3359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.5040 -2.5423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.9050 -3.9175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.4146 -4.0863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
3 5 1 0
5 6 1 0
5 7 1 6
7 8 1 0
7 9 1 0
6 10 1 0
6 11 2 0
10 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 10 1 0
15 16 1 1
16 17 1 0
16 18 2 0
17 19 1 0
19 20 1 0
19 21 1 6
20 22 2 0
22 23 1 0
23 24 1 0
23 25 2 0
24 26 1 0
26 27 1 0
21 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 28 1 0
32 33 2 0
1 34 2 0
34 35 1 0
35 36 1 0
36 37 2 0
37 1 1 0
36 38 1 0
28 39 1 6
12 40 1 6
40 41 2 0
41 42 1 0
42 43 2 0
43 44 1 0
44 45 2 0
45 40 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 607.71Molecular Weight (Monoisotopic): 607.3006AlogP: 2.60#Rotatable Bonds: 12Polar Surface Area: 159.94Molecular Species: NEUTRALHBA: 8HBD: 3#RO5 Violations: 1HBA (Lipinski): 12HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.47CX Basic pKa: ┄CX LogP: 2.31CX LogD: 2.31Aromatic Rings: 2Heavy Atoms: 44QED Weighted: 0.25Np Likeness Score: -0.29
References 1. Kawatkar SP, Gagnon M, Hoesch V, Tiong-Yip C, Johnson K, Ek M, Nilsson E, Lister T, Olsson L, Patel J, Yu Q.. (2016) Design and structure-activity relationships of novel inhibitors of human rhinovirus 3C protease., 26 (14): [PMID:27265257 ] [10.1016/j.bmcl.2016.05.066 ]