(S)-3-Hydroxy-2-phenyl-N-(1-phenylpropyl)-7-methoxyquinoline-4-carboxamide

ID: ALA3813835

PubChem CID: 127048298

Max Phase: Preclinical

Molecular Formula: C26H24N2O3

Molecular Weight: 412.49

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC[C@H](NC(=O)c1c(O)c(-c2ccccc2)nc2cc(OC)ccc12)c1ccccc1

Standard InChI:  InChI=1S/C26H24N2O3/c1-3-21(17-10-6-4-7-11-17)28-26(30)23-20-15-14-19(31-2)16-22(20)27-24(25(23)29)18-12-8-5-9-13-18/h4-16,21,29H,3H2,1-2H3,(H,28,30)/t21-/m0/s1

Standard InChI Key:  UERRLAUBDILGGG-NRFANRHFSA-N

Molfile:  

     RDKit          2D

 31 34  0  0  0  0  0  0  0  0999 V2000
   -1.2964    1.4973    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6111   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2964   -1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964   -1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929   -0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5929    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2964    1.4973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.7486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2907   -2.9981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2489   -3.5938    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5870   -3.7544    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5812   -5.2552    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2768   -5.9975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2409   -5.3917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8775   -6.0115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8739   -7.5115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1711   -8.2648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4720   -7.5180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4757   -6.0180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1785   -5.2648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9086    1.5029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2125    0.7617    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5065    1.5203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4965    3.0203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1925    3.7616    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8985    3.0029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6486   -1.3517    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8911    1.5017    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8894    2.7017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  9 10  2  0
  1 10  1  0
  5 10  1  0
 11 12  2  0
 11 13  1  0
  4 11  1  0
 14 15  1  1
 15 16  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 17 22  2  0
 14 17  1  0
 13 14  1  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 23 28  2  0
  2 23  1  0
  3 29  1  0
 30 31  1  0
  8 30  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3813835

    ---

Associated Targets(Human)

TACR3 Tchem Neurokinin 3 receptor (1696 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 412.49Molecular Weight (Monoisotopic): 412.1787AlogP: 5.50#Rotatable Bonds: 6
Polar Surface Area: 71.45Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 8.29CX Basic pKa: 3.08CX LogP: 6.09CX LogD: 6.04
Aromatic Rings: 4Heavy Atoms: 31QED Weighted: 0.44Np Likeness Score: -0.65

References

1. Yamamoto K, Okazaki S, Ohno H, Matsuda F, Ohkura S, Maeda K, Fujii N, Oishi S..  (2016)  Development of novel NK3 receptor antagonists with reduced environmental impact.,  24  (16): [PMID:27298001] [10.1016/j.bmc.2016.05.054]

Source