The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(2-(3-Amino-6-(1-(2-morpholinoethyl)-1H-pyrazol-4-yl)pyrazin-2-yl)-1H-benzo[d]imidazol-1-yl)phenyl)acrylamide ID: ALA3814824
PubChem CID: 127052095
Max Phase: Preclinical
Molecular Formula: C29H29N9O2
Molecular Weight: 535.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1cccc(-n2c(-c3nc(-c4cnn(CCN5CCOCC5)c4)cnc3N)nc3ccccc32)c1
Standard InChI: InChI=1S/C29H29N9O2/c1-2-26(39)33-21-6-5-7-22(16-21)38-25-9-4-3-8-23(25)35-29(38)27-28(30)31-18-24(34-27)20-17-32-37(19-20)11-10-36-12-14-40-15-13-36/h2-9,16-19H,1,10-15H2,(H2,30,31)(H,33,39)
Standard InChI Key: AHQYTULCADSYLZ-UHFFFAOYSA-N
Molfile:
RDKit 2D
40 45 0 0 0 0 0 0 0 0999 V2000
1.4499 7.7742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5265 8.9573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9759 10.0700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6383 7.9411 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8879 6.3826 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8114 5.1995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2517 3.8078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1749 2.6315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6621 2.8384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2218 4.2301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2965 5.4106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0896 0.0290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9234 1.2700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7453 -1.3220 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4199 1.1671 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0791 -0.1803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2418 -1.4248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2286 -5.1568 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5770 -4.4998 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3688 -3.0143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9013 -2.7729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1870 -4.0774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9648 -6.6317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3957 2.3477 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.5535 -7.1424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2893 -8.6198 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8795 -9.1323 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6185 -10.6094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7671 -11.5741 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.1769 -11.0617 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4380 -9.5846 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
1 4 2 0
1 5 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
6 11 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
12 17 2 0
18 19 2 0
18 20 1 0
13 19 1 0
14 20 1 0
21 22 1 0
21 23 2 0
22 24 2 0
24 25 1 0
25 26 2 0
23 26 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
27 31 1 0
27 32 1 0
26 30 1 0
22 33 1 0
18 21 1 0
8 20 1 0
5 6 1 0
32 34 1 0
34 35 1 0
35 36 1 0
35 40 1 0
36 37 1 0
37 38 1 0
38 39 1 0
39 40 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 535.61Molecular Weight (Monoisotopic): 535.2444AlogP: 3.38#Rotatable Bonds: 8Polar Surface Area: 129.01Molecular Species: NEUTRALHBA: 10HBD: 2#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 6.92CX LogP: 3.14CX LogD: 3.01Aromatic Rings: 5Heavy Atoms: 40QED Weighted: 0.29Np Likeness Score: -1.61
References 1. Hennessy EJ, Chuaqui C, Ashton S, Colclough N, Cross DA, Debreczeni JÉ, Eberlein C, Gingipalli L, Klinowska TC, Orme JP, Sha L, Wu X.. (2016) Utilization of Structure-Based Design to Identify Novel, Irreversible Inhibitors of EGFR Harboring the T790M Mutation., 7 (5): [PMID:27190603 ] [10.1021/acsmedchemlett.6b00058 ]