The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S,E)-ethyl 4-((2S,4R)-1-((S)-3-methyl-2-(5-methylisoxazole-3-carboxamido)butanoyl)-4-phenoxypyrrolidine-2-carboxamido)-5-((S)-2-oxopyrrolidin-3-yl)pent-2-enoate ID: ALA3815050
PubChem CID: 127049320
Max Phase: Preclinical
Molecular Formula: C32H41N5O8
Molecular Weight: 623.71
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCOC(=O)/C=C/[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@@H]1C[C@@H](Oc2ccccc2)CN1C(=O)[C@@H](NC(=O)c1cc(C)on1)C(C)C
Standard InChI: InChI=1S/C32H41N5O8/c1-5-43-27(38)12-11-22(16-21-13-14-33-29(21)39)34-31(41)26-17-24(44-23-9-7-6-8-10-23)18-37(26)32(42)28(19(2)3)35-30(40)25-15-20(4)45-36-25/h6-12,15,19,21-22,24,26,28H,5,13-14,16-18H2,1-4H3,(H,33,39)(H,34,41)(H,35,40)/b12-11+/t21-,22+,24+,26-,28-/m0/s1
Standard InChI Key: LXLPMDZKFRCJEG-XAYVYUONSA-N
Molfile:
RDKit 2D
46 49 0 0 0 0 0 0 0 0999 V2000
-3.8116 -8.5851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9227 -7.3758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4309 -7.5400 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.4050 -6.2770 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.5420 -6.3307 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9498 -6.4949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1424 -4.9552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4307 -3.9891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3350 -4.8215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8372 -5.2877 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4322 -7.5937 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3786 -3.8595 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8056 -3.8679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3372 -5.2929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2111 -6.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5939 -7.8779 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4051 -6.3907 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.4694 -9.0970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9631 -8.9509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8522 -10.4651 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8372 -10.1710 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.3309 -10.0249 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2050 -11.2449 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.8266 -8.9321 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.6987 -11.0989 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.3976 -12.0744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7276 -11.6841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6619 -12.8106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0355 -12.2079 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8868 -10.7153 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.4212 -10.3955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.0034 -9.4870 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2987 -8.5622 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.7672 -9.9872 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.5567 -10.8731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3401 -9.9956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.5609 -12.0731 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3160 -12.5955 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
2 4 2 0
3 5 1 0
5 6 1 0
5 7 1 1
7 8 1 0
7 9 1 0
6 10 1 0
6 11 2 0
10 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 10 1 0
15 16 1 1
16 17 1 0
16 18 2 0
17 19 1 0
19 20 1 0
19 21 1 6
20 22 2 0
22 23 1 0
23 24 1 0
23 25 2 0
24 26 1 0
26 27 1 0
21 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 28 1 0
32 33 2 0
1 34 2 0
34 35 1 0
35 36 1 0
36 37 2 0
37 1 1 0
36 38 1 0
28 39 1 6
41 40 1 0
13 40 1 6
41 42 2 0
42 43 1 0
43 44 2 0
44 45 1 0
45 46 2 0
46 41 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 623.71Molecular Weight (Monoisotopic): 623.2955AlogP: 1.92#Rotatable Bonds: 13Polar Surface Area: 169.17Molecular Species: NEUTRALHBA: 9HBD: 3#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.46CX Basic pKa: ┄CX LogP: 1.71CX LogD: 1.71Aromatic Rings: 2Heavy Atoms: 45QED Weighted: 0.22Np Likeness Score: -0.29
References 1. Kawatkar SP, Gagnon M, Hoesch V, Tiong-Yip C, Johnson K, Ek M, Nilsson E, Lister T, Olsson L, Patel J, Yu Q.. (2016) Design and structure-activity relationships of novel inhibitors of human rhinovirus 3C protease., 26 (14): [PMID:27265257 ] [10.1016/j.bmcl.2016.05.066 ]