The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3-(2-(6-(1-(1-Acetylpiperidin-4-yl)-1H-pyrazol-4-yl)-3-aminopyrazin-2-yl)-1H-benzo[d]imidazol-1-yl)phenyl)acrylamide ID: ALA3815124
PubChem CID: 127050256
Max Phase: Preclinical
Molecular Formula: C30H29N9O2
Molecular Weight: 547.62
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: C=CC(=O)Nc1cccc(-n2c(-c3nc(-c4cnn(C5CCN(C(C)=O)CC5)c4)cnc3N)nc3ccccc32)c1
Standard InChI: InChI=1S/C30H29N9O2/c1-3-27(41)34-21-7-6-8-23(15-21)39-26-10-5-4-9-24(26)36-30(39)28-29(31)32-17-25(35-28)20-16-33-38(18-20)22-11-13-37(14-12-22)19(2)40/h3-10,15-18,22H,1,11-14H2,2H3,(H2,31,32)(H,34,41)
Standard InChI Key: AJAYMEAWIMWBDE-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 46 0 0 0 0 0 0 0 0999 V2000
1.4499 7.7742 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5265 8.9573 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9759 10.0700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6383 7.9411 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.8879 6.3826 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8114 5.1995 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2517 3.8078 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1749 2.6315 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6621 2.8384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.2218 4.2301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2965 5.4106 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0896 0.0290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9234 1.2700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7453 -1.3220 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.4199 1.1671 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0791 -0.1803 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2418 -1.4248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2286 -5.1568 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.5770 -4.4998 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.3688 -3.0143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9013 -2.7729 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1870 -4.0774 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9674 -6.6347 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3957 2.3477 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.0374 -7.6789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6659 -9.1322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2216 -9.5371 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.1488 -8.4888 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5202 -7.0355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.8470 -10.9905 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6911 -11.3128 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.7038 -11.8306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
1 4 2 0
1 5 1 0
6 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
6 11 2 0
12 13 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
12 17 2 0
18 19 2 0
18 20 1 0
13 19 1 0
14 20 1 0
21 22 1 0
21 23 2 0
22 24 2 0
24 25 1 0
25 26 2 0
23 26 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
27 31 1 0
27 32 1 0
26 30 1 0
22 33 1 0
18 21 1 0
8 20 1 0
5 6 1 0
32 34 1 0
32 38 1 0
34 35 1 0
35 36 1 0
36 37 1 0
37 38 1 0
36 39 1 0
39 40 2 0
39 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 547.62Molecular Weight (Monoisotopic): 547.2444AlogP: 4.24#Rotatable Bonds: 6Polar Surface Area: 136.85Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 11HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 1.96CX LogP: 2.59CX LogD: 2.59Aromatic Rings: 5Heavy Atoms: 41QED Weighted: 0.30Np Likeness Score: -1.28
References 1. Hennessy EJ, Chuaqui C, Ashton S, Colclough N, Cross DA, Debreczeni JÉ, Eberlein C, Gingipalli L, Klinowska TC, Orme JP, Sha L, Wu X.. (2016) Utilization of Structure-Based Design to Identify Novel, Irreversible Inhibitors of EGFR Harboring the T790M Mutation., 7 (5): [PMID:27190603 ] [10.1021/acsmedchemlett.6b00058 ]