The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(4-(2-(1H-benzo[d][1,2,3]triazol-1-yl)-2-(4-(methoxycarbonyl)phenyl)-5-phenylpent-4-enyl)phenyl)difluoromethylphosphonic acid ID: ALA3817887
PubChem CID: 10167662
Max Phase: Preclinical
Molecular Formula: C32H28F2N3O5P
Molecular Weight: 603.56
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COC(=O)c1ccc(C(C/C=C/c2ccccc2)(Cc2ccc(C(F)(F)P(=O)(O)O)cc2)n2nnc3ccccc32)cc1
Standard InChI: InChI=1S/C32H28F2N3O5P/c1-42-30(38)25-15-19-26(20-16-25)31(21-7-10-23-8-3-2-4-9-23,37-29-12-6-5-11-28(29)35-36-37)22-24-13-17-27(18-14-24)32(33,34)43(39,40)41/h2-20H,21-22H2,1H3,(H2,39,40,41)/b10-7+
Standard InChI Key: GWWTUJWRRCTCSI-JXMROGBWSA-N
Molfile:
RDKit 2D
43 47 0 0 0 0 0 0 0 0999 V2000
9.4298 -3.8791 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
9.0567 -2.7386 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2557 -3.6321 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.5897 -5.7824 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.5905 -6.9011 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1220 -6.5951 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6528 -5.1704 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6520 -4.0517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1205 -4.3576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0571 -8.3276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0557 -9.4455 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2314 -8.5744 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.4288 -10.5860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1825 -2.6263 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1826 -1.5072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7132 -2.3206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2870 -3.4396 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7563 -3.1339 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.7564 -4.2530 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2255 -3.9496 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2228 -5.0701 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7511 -6.4940 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2821 -6.7974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2848 -5.6770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.6520 -1.8129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.6532 -0.6959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1212 -1.0044 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5880 -2.4299 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5868 -3.5469 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1189 -3.2384 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.0591 -1.6216 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
9.6860 -0.4811 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
10.8601 -0.7281 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.2334 -1.8684 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 2 0
9 4 1 0
10 11 1 0
10 12 2 0
5 10 1 0
11 13 1 0
8 14 1 0
14 15 1 0
14 16 1 0
14 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
22 23 2 0
23 24 1 0
24 25 2 0
25 20 1 0
16 26 1 0
26 27 2 0
27 29 1 0
28 16 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
15 34 1 0
34 35 2 0
35 36 1 0
36 37 2 0
37 38 1 0
38 39 2 0
39 34 1 0
37 2 1 0
2 40 1 0
40 41 1 0
40 42 1 0
40 43 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 603.56Molecular Weight (Monoisotopic): 603.1735AlogP: 6.53#Rotatable Bonds: 10Polar Surface Area: 114.54Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: 2HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 2CX Acidic pKa: 0.74CX Basic pKa: 0.13CX LogP: 6.37CX LogD: 4.22Aromatic Rings: 5Heavy Atoms: 43QED Weighted: 0.14Np Likeness Score: -0.46
References 1. Li X, Wang L, Shi D.. (2016) The design strategy of selective PTP1B inhibitors over TCPTP., 24 (16): [PMID:27353889 ] [10.1016/j.bmc.2016.06.035 ] 2. Kousaxidis A, Petrou A, Lavrentaki V, Fesatidou M, Nicolaou I, Geronikaki A.. (2020) Aldose reductase and protein tyrosine phosphatase 1B inhibitors as a promising therapeutic approach for diabetes mellitus., 207 [PMID:32871344 ] [10.1016/j.ejmech.2020.112742 ]