(4-(2-(1H-benzo[d][1,2,3]triazol-1-yl)-2-(4-(methoxycarbonyl)phenyl)-5-phenylpent-4-enyl)phenyl)difluoromethylphosphonic acid

ID: ALA3817887

PubChem CID: 10167662

Max Phase: Preclinical

Molecular Formula: C32H28F2N3O5P

Molecular Weight: 603.56

Molecule Type: Small molecule

Names and Identifiers

Canonical SMILES:  COC(=O)c1ccc(C(C/C=C/c2ccccc2)(Cc2ccc(C(F)(F)P(=O)(O)O)cc2)n2nnc3ccccc32)cc1

Standard InChI:  InChI=1S/C32H28F2N3O5P/c1-42-30(38)25-15-19-26(20-16-25)31(21-7-10-23-8-3-2-4-9-23,37-29-12-6-5-11-28(29)35-36-37)22-24-13-17-27(18-14-24)32(33,34)43(39,40)41/h2-20H,21-22H2,1H3,(H2,39,40,41)/b10-7+

Standard InChI Key:  GWWTUJWRRCTCSI-JXMROGBWSA-N

Molfile:  

     RDKit          2D

 43 47  0  0  0  0  0  0  0  0999 V2000
    9.4298   -3.8791    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.0567   -2.7386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2557   -3.6321    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    4.5897   -5.7824    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5905   -6.9011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1220   -6.5951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6528   -5.1704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6520   -4.0517    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1205   -4.3576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0571   -8.3276    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0557   -9.4455    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2314   -8.5744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4288  -10.5860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1825   -2.6263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1826   -1.5072    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138   -1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7132   -2.3206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2870   -3.4396    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7563   -3.1339    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7564   -4.2530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2255   -3.9496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2228   -5.0701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7511   -6.4940    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2821   -6.7974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2848   -5.6770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6520   -1.8129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6532   -0.6959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1212   -1.0044    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5880   -2.4299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5868   -3.5469    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1189   -3.2384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0591   -1.6216    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    9.6860   -0.4811    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8601   -0.7281    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.2334   -1.8684    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
 10 11  1  0
 10 12  2  0
  5 10  1  0
 11 13  1  0
  8 14  1  0
 14 15  1  0
 14 16  1  0
 14 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  2  0
 23 24  1  0
 24 25  2  0
 25 20  1  0
 16 26  1  0
 26 27  2  0
 27 29  1  0
 28 16  1  0
 28 29  2  0
 29 30  1  0
 30 31  2  0
 31 32  1  0
 32 33  2  0
 33 28  1  0
 15 34  1  0
 34 35  2  0
 35 36  1  0
 36 37  2  0
 37 38  1  0
 38 39  2  0
 39 34  1  0
 37  2  1  0
  2 40  1  0
 40 41  1  0
 40 42  1  0
 40 43  2  0
M  END

Alternative Forms

1. Parent:

   

   ALA3817887

   ({4-[(4E)-2-(1H-1,2,3-benzotriazol-1-yl)-2-[4-(methoxycarbonyl)phenyl]-5-phenylpent-4-en-1-yl]phenyl}difluoromethyl)phosphonic acid

Molecule Features

Natural Product: No

Oral: No

Chemical Probe: No

Parenteral: No

Molecule Type: Small molecule

Topical: No

First In Class: No

Black Box: No

Chirality: No

Availability: No

Prodrug: No

Calculated Properties

Molecular Weight: 603.56

Molecular Weight (Monoisotopic): 603.1735

AlogP: 6.53

#Rotatable Bonds: 10

Polar Surface Area: 114.54

Molecular Species: ACID

HBA: 6

HBD: 2

#RO5 Violations: 2

HBA (Lipinski): 8

HBD (Lipinski): 2

#RO5 Violations (Lipinski): 2

CX Acidic pKa: 0.74

CX Basic pKa: 0.13

CX LogP: 6.37

CX LogD: 4.22

Aromatic Rings: 5

Heavy Atoms: 43

QED Weighted: 0.14

Np Likeness Score: -0.46

References

1. Li X, Wang L, Shi D..  (2016)  The design strategy of selective PTP1B inhibitors over TCPTP.,  24  (16): [PMID:27353889] [10.1016/j.bmc.2016.06.035]

2. Kousaxidis A, Petrou A, Lavrentaki V, Fesatidou M, Nicolaou I, Geronikaki A..  (2020)  Aldose reductase and protein tyrosine phosphatase 1B inhibitors as a promising therapeutic approach for diabetes mellitus.,  207  [PMID:32871344] [10.1016/j.ejmech.2020.112742]

Source

Source(1):

• Scientific Literature