(20R)-21-(Bis(trifluoromethyl)hydroxymethyl)pregn-5-en-3beta,20-diol

ID: ALA3817972

Cas Number: 102586-30-1

PubChem CID: 97290923

Max Phase: Preclinical

Molecular Formula: C24H34F6O3

Molecular Weight: 484.52

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  C[C@]12CC[C@H]3[C@@H](CC=C4C[C@@H](O)CC[C@@]43C)[C@@H]1CC[C@@H]2[C@H](O)CC(O)(C(F)(F)F)C(F)(F)F

Standard InChI:  InChI=1S/C24H34F6O3/c1-20-9-7-14(31)11-13(20)3-4-15-16-5-6-18(21(16,2)10-8-17(15)20)19(32)12-22(33,23(25,26)27)24(28,29)30/h3,14-19,31-33H,4-12H2,1-2H3/t14-,15-,16-,17-,18+,19+,20-,21-/m0/s1

Standard InChI Key:  OHKBOEWLASAFLW-YHVBFONYSA-N

Molfile:  

     RDKit          2D

 37 40  0  0  0  0  0  0  0  0999 V2000
    8.5033    2.5246    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1993    3.2675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1910    4.7682    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1792   -0.4015    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1792   -1.8432    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9382   -2.5732    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9565    0.3102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6790   -0.3832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6790   -1.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4197   -2.5550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8212   -1.8067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4380    0.3285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8030   -0.3650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8030    2.5185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4562    1.7885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0440    1.7885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0440    0.3467    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5625    0.3285    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5625    1.8067    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3032    2.5367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6930    0.8167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2209   -2.4390    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0413    2.9885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5993    3.2532    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9034    2.5103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5927    4.4532    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2059    2.0675    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2265    5.3746    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    7.1838    5.9682    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    6.1483    5.3621    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.5395    3.1300    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    9.5458    1.9302    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    8.5099    1.3246    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.6715   -0.8608    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4332   -0.6715    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2979   -0.6205    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3325    1.5372    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0
  3  2  1  0
  4  5  1  0
  4  7  1  0
  5  6  1  0
  6  9  1  0
  8  7  1  0
  8  9  1  0
  8 12  1  0
  9 10  2  0
 10 11  1  0
 11 13  1  0
 12 13  1  0
 12 15  1  0
 13 17  1  0
 16 14  1  0
 14 15  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 16  1  0
  8 21  1  1
  5 22  1  1
 16 23  1  1
 20 24  1  0
 24 25  1  0
 24 26  1  6
 25  2  1  0
  2 27  1  0
  3 28  1  0
  3 29  1  0
  3 30  1  0
  1 31  1  0
  1 32  1  0
  1 33  1  0
 13 34  1  1
 12 35  1  6
 17 36  1  6
 20 37  1  6
M  END

Associated Targets(Human)

FGF2 Tchem Basic fibroblast growth factor (185 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
NCI-H520 (551 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Mus musculus (284745 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 484.52Molecular Weight (Monoisotopic): 484.2412AlogP: 5.53#Rotatable Bonds: 3
Polar Surface Area: 60.69Molecular Species: NEUTRALHBA: 3HBD: 3
#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 7.91CX Basic pKa: CX LogP: 4.28CX LogD: 4.16
Aromatic Rings: Heavy Atoms: 33QED Weighted: 0.36Np Likeness Score: 1.83

References

1. Castelli R, Giacomini A, Anselmi M, Bozza N, Vacondio F, Rivara S, Matarazzo S, Presta M, Mor M, Ronca R..  (2016)  Synthesis, Structural Elucidation, and Biological Evaluation of NSC12, an Orally Available Fibroblast Growth Factor (FGF) Ligand Trap for the Treatment of FGF-Dependent Lung Tumors.,  59  (10): [PMID:27138345] [10.1021/acs.jmedchem.5b02021]
2. Castelli R, Taranto S, Furiassi L, Bozza N, Marseglia G, Ferlenghi F, Rivara S, Retini M, Bedini A, Spadoni G, Matarazzo S, Ronca R, Presta M, Mor M, Giacomini A..  (2021)  Chemical modification of NSC12 leads to a specific FGF-trap with antitumor activity in multiple myeloma.,  221  [PMID:34004471] [10.1016/j.ejmech.2021.113529]

Source