The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((2-butyl-4-chloro-1-(4-methoxybenzyl)-1H-imidazol-5-yl)methyleneamino)-6-morpholino-1H-benzo[de]isoquinoline-1,3(2H)-dione ID: ALA3818100
PubChem CID: 127052169
Max Phase: Preclinical
Molecular Formula: C32H32ClN5O4
Molecular Weight: 586.09
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCc1nc(Cl)c(/C=N/N2C(=O)c3cccc4c(N5CCOCC5)ccc(c34)C2=O)n1Cc1ccc(OC)cc1
Standard InChI: InChI=1S/C32H32ClN5O4/c1-3-4-8-28-35-30(33)27(37(28)20-21-9-11-22(41-2)12-10-21)19-34-38-31(39)24-7-5-6-23-26(36-15-17-42-18-16-36)14-13-25(29(23)24)32(38)40/h5-7,9-14,19H,3-4,8,15-18,20H2,1-2H3/b34-19+
Standard InChI Key: ISRIEWNQUBBZKL-ALQBTCKLSA-N
Molfile:
RDKit 2D
42 47 0 0 0 0 0 0 0 0999 V2000
-1.2811 -2.2629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0053 0.0053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0114 -1.4911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2935 0.7482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8911 2.2340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5985 3.0058 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2997 2.2447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5861 -0.0053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5800 -1.5018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8725 -2.2736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1714 -1.5125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1776 -0.0160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8849 0.7376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2597 2.8435 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.7618 2.7258 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2749 -3.7637 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6016 4.5063 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 5.2602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3070 6.7611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5205 7.6209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0570 9.0475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5570 9.0475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0935 7.6209 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5636 -4.5305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5438 -6.0303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2350 -6.7631 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0541 -5.9961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0343 -4.4962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3211 10.2614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2913 11.6316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5883 12.8476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0986 13.9432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6596 7.2433 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.3268 7.1441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6254 5.6733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0467 5.1937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3422 3.7231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2164 2.7319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7950 3.2114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4996 4.6820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5090 1.2599 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7575 0.6002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 9 2 0
4 2 1 0
2 3 2 0
3 1 1 0
4 8 2 0
13 5 1 0
5 6 1 0
6 7 1 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
7 14 2 0
5 15 2 0
1 16 1 0
6 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 19 1 0
16 24 1 0
16 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
22 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
20 33 1 0
23 34 1 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
38 41 1 0
41 42 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 586.09Molecular Weight (Monoisotopic): 585.2143AlogP: 5.56#Rotatable Bonds: 9Polar Surface Area: 89.26Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 3.47CX LogP: 5.84CX LogD: 5.84Aromatic Rings: 4Heavy Atoms: 42QED Weighted: 0.19Np Likeness Score: -1.14
References 1. Gong H, Baathulaa K, Lv J, Cai G, Zhou C. (2016) Synthesis and biological evaluation of Schiff base-linked imidazolyl naphthalimides as novel potential anti-MRSA agents, 7 (5): [10.1039/C5MD00574D ]