The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N1-[1-[3-[4-(1H-Imidazol-1-yl)phenyl]-1-(2-nitrophenyl)-3-oxo]propyl]-pyridine-2-carboxamidrazone ID: ALA3818342
PubChem CID: 127048363
Max Phase: Preclinical
Molecular Formula: C24H21N7O3
Molecular Weight: 455.48
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: N/C(=N/NC(CC(=O)c1ccc(-n2ccnc2)cc1)c1ccccc1[N+](=O)[O-])c1ccccn1
Standard InChI: InChI=1S/C24H21N7O3/c25-24(20-6-3-4-12-27-20)29-28-21(19-5-1-2-7-22(19)31(33)34)15-23(32)17-8-10-18(11-9-17)30-14-13-26-16-30/h1-14,16,21,28H,15H2,(H2,25,29)
Standard InChI Key: MINCJWQWQTUHLQ-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 -1.5004 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9511 -0.8815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9531 -1.9978 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2010 -3.2956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7343 -2.9815 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6003 1.4977 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6024 2.6977 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.8990 0.7455 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2003 1.4932 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2029 2.9939 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4990 0.7409 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-7.8003 1.4887 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-9.0990 0.7364 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.1389 1.3352 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-9.0978 -0.7644 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-10.3947 -1.5182 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-10.3904 -3.0182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0893 -3.7645 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7924 -3.0108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7966 -1.5109 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9042 3.7446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9048 5.2446 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2041 5.9941 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5029 5.2436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5023 3.7436 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8033 2.9954 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-8.8419 3.5965 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.8047 1.9954 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 1 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 7 1 0
1 7 1 0
4 12 1 0
12 13 2 0
12 14 1 0
14 15 1 0
15 16 1 0
15 17 1 0
17 18 1 0
18 19 2 0
19 20 1 0
19 21 1 0
21 22 2 0
22 23 1 0
23 24 2 0
24 25 1 0
25 26 2 0
26 21 1 0
16 27 2 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 16 1 0
32 33 2 0
32 34 1 0
31 32 1 0
M CHG 2 32 1 34 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 455.48Molecular Weight (Monoisotopic): 455.1706AlogP: 3.40#Rotatable Bonds: 9Polar Surface Area: 141.33Molecular Species: NEUTRALHBA: 8HBD: 2#RO5 Violations: ┄HBA (Lipinski): 10HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 6.25CX LogP: 2.95CX LogD: 2.92Aromatic Rings: 4Heavy Atoms: 34QED Weighted: 0.13Np Likeness Score: -1.58
References 1. Zampieri D, Mamolo MG, Vio L, Romano M, Skoko N, Baralle M, Pau V, De Logu A.. (2016) Antimycobacterial activity of new N(1)-[1-[1-aryl-3-[4-(1H-imidazol-1-yl)phenyl]-3-oxo]propyl]-pyridine-2-carboxamidrazone derivatives., 26 (14): [PMID:27241693 ] [10.1016/j.bmcl.2016.05.053 ]