The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
[(4-{[(S)-1-{(S)-1-Carbamoyl-2-[4-(difluoro-phosphono-methyl)-phenyl]-ethylcarbamoyl}-2-(4-hydroxy-phenyl)-ethylcarbamoyl]-methyl}-phenyl)-difluoro-methyl]-phosphonic acid ID: ALA3818452
PubChem CID: 127051219
Max Phase: Preclinical
Molecular Formula: C28H29F4N3O10P2
Molecular Weight: 705.49
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: NC(=O)[C@H](Cc1ccc(C(F)(F)P(=O)(O)O)cc1)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)Cc1ccc(C(F)(F)P(=O)(O)O)cc1
Standard InChI: InChI=1S/C28H29F4N3O10P2/c29-27(30,46(40,41)42)19-7-1-16(2-8-19)13-22(25(33)38)35-26(39)23(14-17-5-11-21(36)12-6-17)34-24(37)15-18-3-9-20(10-4-18)28(31,32)47(43,44)45/h1-12,22-23,36H,13-15H2,(H2,33,38)(H,34,37)(H,35,39)(H2,40,41,42)(H2,43,44,45)/t22-,23-/m0/s1
Standard InChI Key: UVMSRZSQDQTMKV-GOTSBHOMSA-N
Molfile:
RDKit 2D
47 49 0 0 0 0 0 0 0 0999 V2000
-1.0394 3.6005 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0391 2.4007 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
4.1794 -17.0990 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.2188 -16.4993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1797 -15.8991 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2993 3.7521 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
2.3387 3.1524 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2992 4.9521 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.3384 4.3522 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 -3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3039 -3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.3421 -3.1476 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3070 -5.2502 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6078 -5.9988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6109 -7.4996 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9078 -5.2488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2078 -5.9988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5082 -5.2510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8060 -6.0033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8034 -7.5033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5031 -8.2510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2053 -7.4988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8416 -8.1051 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5727 -8.1014 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.9117 -8.2481 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.9148 -9.7490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6179 -10.5043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5766 -9.9079 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6217 -11.7043 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2157 -10.4975 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2188 -11.9983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5178 -12.7484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5178 -14.2484 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2188 -14.9984 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9198 -14.2485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9197 -12.7485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5181 -17.2505 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
7.5575 -16.6508 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.5182 -18.4505 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.5573 -17.8506 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2 1 1 0
3 2 1 0
5 4 1 0
6 5 1 0
7 8 2 0
8 9 1 0
9 10 2 0
10 11 1 0
11 12 2 0
12 7 1 0
9 2 1 0
2 13 1 0
13 14 1 0
13 15 2 0
13 16 1 0
12 17 1 0
17 18 1 0
18 19 2 0
18 20 1 0
20 21 1 0
21 22 1 0
21 23 1 1
23 24 1 0
24 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 24 1 0
27 30 1 0
22 31 2 0
22 32 1 0
32 33 1 0
33 34 1 0
34 35 1 0
34 36 2 0
33 37 1 1
37 38 1 0
38 39 2 0
39 40 1 0
40 41 2 0
41 42 1 0
42 43 2 0
43 38 1 0
41 5 1 0
5 44 1 0
44 45 1 0
44 46 2 0
44 47 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 705.49Molecular Weight (Monoisotopic): 705.1264AlogP: 2.33#Rotatable Bonds: 14Polar Surface Area: 236.58Molecular Species: ACIDHBA: 6HBD: 8#RO5 Violations: 2HBA (Lipinski): 13HBD (Lipinski): 9#RO5 Violations (Lipinski): 3CX Acidic pKa: 0.19CX Basic pKa: ┄CX LogP: 1.49CX LogD: -4.03Aromatic Rings: 3Heavy Atoms: 47QED Weighted: 0.09Np Likeness Score: -0.16