The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
6-((6-(5-aminopentylamino)pyridin-3-yl)methyl)-7-(3-hydroxypropylthio)-4-isobutyl-2-methyl-2,6-dihydro-1H-pyrrolo[3,4-d]pyridazin-1-one ID: ALA3818476
PubChem CID: 127052808
Max Phase: Preclinical
Molecular Formula: C25H38N6O2S
Molecular Weight: 486.69
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)Cc1nn(C)c(=O)c2c(SCCCO)n(Cc3ccc(NCCCCCN)nc3)cc12
Standard InChI: InChI=1S/C25H38N6O2S/c1-18(2)14-21-20-17-31(25(34-13-7-12-32)23(20)24(33)30(3)29-21)16-19-8-9-22(28-15-19)27-11-6-4-5-10-26/h8-9,15,17-18,32H,4-7,10-14,16,26H2,1-3H3,(H,27,28)
Standard InChI Key: BGTLVURPDILZRC-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
-2.3155 0.7475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9991 2.7132 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.9971 -3.0138 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2935 -3.7700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2889 -4.9699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3352 -3.1743 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.3560 1.3452 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1812 2.6271 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
3.6500 2.9355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1182 4.3614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5870 4.6698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9614 5.8100 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.0872 0.0320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8506 -1.2602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3709 -3.8465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8709 -3.8583 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.1108 -2.5652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1107 -2.5417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3505 -1.2485 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1288 -5.1419 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.3867 -6.4465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1447 -7.7419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4026 -9.0464 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.1605 -10.3418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4184 -11.6463 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0244 -12.6821 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
1 4 1 0
2 3 2 0
3 6 1 0
5 4 1 0
5 6 1 0
6 7 2 0
7 8 1 0
8 9 1 0
9 5 2 0
4 10 2 0
3 11 1 0
11 12 1 0
12 13 1 0
12 14 1 0
1 15 1 0
9 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
8 21 1 0
21 22 1 0
22 27 1 0
26 23 1 0
23 24 2 0
24 25 1 0
25 22 2 0
26 27 2 0
23 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
32 33 1 0
33 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 486.69Molecular Weight (Monoisotopic): 486.2777AlogP: 3.39#Rotatable Bonds: 14Polar Surface Area: 110.99Molecular Species: BASEHBA: 9HBD: 3#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 4#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 10.21CX LogP: 2.58CX LogD: -0.10Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.24Np Likeness Score: -0.73
References 1. Nair RN, Mishra JK, Li F, Tortosa M, Yang C, Doherty JR, Cameron M, Cleveland JL, Roush WR, Bannister TD.. (2016) Exploiting the co-reliance of tumours upon transport of amino acids and lactate: Gln and Tyr conjugates of MCT1 inhibitors., 7 (5): [PMID:27347360 ] [10.1039/c5md00579e ] 2. Murray, Clare M CM and 26 more authors. 2005-12 Monocarboxylate transporter MCT1 is a target for immunosuppression. [PMID:16370372 ] 3. Wang, Hui H and 5 more authors. 2014-09-11 Synthesis and structure-activity relationships of pteridine dione and trione monocarboxylate transporter 1 inhibitors. [PMID:25068893 ] 4. Nair, Reji N and 9 more authors. 2016-05-01 Exploiting the co-reliance of tumours upon transport of amino acids and lactate: Gln and Tyr conjugates of MCT1 inhibitors. [PMID:27347360 ]