1-[4-(6-Methoxy-benzothiazol-2-yl)-2-methyl-phenyl]-1H-benzotriazole

ID: ALA3819465

PubChem CID: 127052194

Max Phase: Preclinical

Molecular Formula: C21H16N4OS

Molecular Weight: 372.45

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1ccc2nc(-c3ccc(-n4nnc5ccccc54)c(C)c3)sc2c1

Standard InChI:  InChI=1S/C21H16N4OS/c1-13-11-14(21-22-17-9-8-15(26-2)12-20(17)27-21)7-10-18(13)25-19-6-4-3-5-16(19)23-24-25/h3-12H,1-2H3

Standard InChI Key:  GVFWALAGANBRQV-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 27 31  0  0  0  0  0  0  0  0999 V2000
    1.7138   -1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5889    0.0182    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7138    1.2033    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2917   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028    1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155    0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3155   -0.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0028   -1.5132    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1852   -2.6281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2781   -3.8165    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8565   -5.2005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3443   -5.3916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2537   -4.1987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6753   -2.8147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0879   -3.6632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1413   -8.0438    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.9230   -6.7763    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3512   -7.0908    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.4957   -8.5772    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1229   -9.1692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7115   -9.4626    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5281  -10.9712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1553  -11.5632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9324  -10.6610    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9878  -13.0547    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8885  -13.5357    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  1  5  1  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  5  9  2  0
  4  6  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 10 15  2  0
 11 16  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 17 21  1  0
 22 23  1  0
 23 24  2  0
 24 25  1  0
 21 25  2  0
 20 22  2  0
 26 27  1  0
 24 26  1  0
 13 18  1  0
  1 10  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3819465

    ---

Associated Targets(Human)

Ca9-22 (362 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 372.45Molecular Weight (Monoisotopic): 372.1045AlogP: 5.01#Rotatable Bonds: 3
Polar Surface Area: 52.83Molecular Species: NEUTRALHBA: 6HBD:
#RO5 Violations: 1HBA (Lipinski): 5HBD (Lipinski): #RO5 Violations (Lipinski): 1
CX Acidic pKa: CX Basic pKa: 2.36CX LogP: 5.60CX LogD: 5.60
Aromatic Rings: 5Heavy Atoms: 27QED Weighted: 0.45Np Likeness Score: -2.20

References

1. Senadi GC, Liao C, Kuo K, Lin J, Chang L, Wang JJ, Hu W.  (2016)  Design, synthesis and antimetastatic evaluation of 1-benzothiazolylphenylbenzotriazoles for photodynamic therapy in oral cancer cells,  (6): [10.1039/C6MD00034G]

Source