The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((2-Butyl-4-chloro-1-(4-nitrobenzyl)-1H-imidazol-5-yl)methyleneamino)-6-morpholino-1Hbenzo[de]isoquinoline-1,3(2H)-dione ID: ALA3819471
PubChem CID: 127053058
Max Phase: Preclinical
Molecular Formula: C31H29ClN6O5
Molecular Weight: 601.06
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CCCCc1nc(Cl)c(/C=N/N2C(=O)c3cccc4c(N5CCOCC5)ccc(c34)C2=O)n1Cc1ccc([N+](=O)[O-])cc1
Standard InChI: InChI=1S/C31H29ClN6O5/c1-2-3-7-27-34-29(32)26(36(27)19-20-8-10-21(11-9-20)38(41)42)18-33-37-30(39)23-6-4-5-22-25(35-14-16-43-17-15-35)13-12-24(28(22)23)31(37)40/h4-6,8-13,18H,2-3,7,14-17,19H2,1H3/b33-18+
Standard InChI Key: NGTLISZUSQPXJD-DPNNOFEESA-N
Molfile:
RDKit 2D
43 48 0 0 0 0 0 0 0 0999 V2000
-1.2811 -2.2629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0053 0.0053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0114 -1.4911 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2935 0.7482 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8911 2.2340 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5985 3.0058 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.2997 2.2447 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5861 -0.0053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5800 -1.5018 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8725 -2.2736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1714 -1.5125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1776 -0.0160 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8849 0.7376 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2597 2.8435 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.7618 2.7258 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.2749 -3.7637 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.6016 4.5063 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 5.2602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3070 6.7611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5205 7.6209 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0570 9.0475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.5570 9.0475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0935 7.6209 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5636 -4.5305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5438 -6.0303 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2350 -6.7631 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0541 -5.9961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0343 -4.4962 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3211 10.2614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2913 11.6316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5883 12.8476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0986 13.9432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6596 7.2433 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.3268 7.1441 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6254 5.6733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.0467 5.1937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3422 3.7231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2164 2.7319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7950 3.2114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4996 4.6820 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5090 1.2599 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7575 0.6002 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.6454 0.8744 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 9 2 0
4 2 1 0
2 3 2 0
3 1 1 0
4 8 2 0
13 5 1 0
5 6 1 0
6 7 1 0
7 4 1 0
8 9 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 8 1 0
7 14 2 0
5 15 2 0
1 16 1 0
6 17 1 0
17 18 2 0
18 19 1 0
19 20 2 0
20 21 1 0
21 22 2 0
22 23 1 0
23 19 1 0
16 24 1 0
16 28 1 0
24 25 1 0
25 26 1 0
26 27 1 0
27 28 1 0
22 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
20 33 1 0
23 34 1 0
34 35 1 0
35 36 2 0
36 37 1 0
37 38 2 0
38 39 1 0
39 40 2 0
40 35 1 0
41 42 2 0
41 43 1 0
38 41 1 0
M CHG 2 41 1 43 -1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 601.06Molecular Weight (Monoisotopic): 600.1888AlogP: 5.46#Rotatable Bonds: 9Polar Surface Area: 123.17Molecular Species: NEUTRALHBA: 9HBD: ┄#RO5 Violations: 2HBA (Lipinski): 11HBD (Lipinski): ┄#RO5 Violations (Lipinski): 3CX Acidic pKa: ┄CX Basic pKa: 3.47CX LogP: 5.94CX LogD: 5.94Aromatic Rings: 4Heavy Atoms: 43QED Weighted: 0.11Np Likeness Score: -1.34
References 1. Gong H, Baathulaa K, Lv J, Cai G, Zhou C. (2016) Synthesis and biological evaluation of Schiff base-linked imidazolyl naphthalimides as novel potential anti-MRSA agents, 7 (5): [10.1039/C5MD00574D ]