The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(S)-(4-(3-Cyclohexyl-4-(pyrrolidin-3-yloxy)benzoyl)piperazin-1-yl)(3-fluoro-5-(piperazin-1-yl)phenyl)methanone didihydrochloride ID: ALA3819506
PubChem CID: 127052189
Max Phase: Preclinical
Molecular Formula: C32H44Cl2FN5O3
Molecular Weight: 563.72
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: Cl.Cl.O=C(c1cc(F)cc(N2CCNCC2)c1)N1CCN(C(=O)c2ccc(O[C@H]3CCNC3)c(C3CCCCC3)c2)CC1
Standard InChI: InChI=1S/C32H42FN5O3.2ClH/c33-26-18-25(19-27(21-26)36-12-10-34-11-13-36)32(40)38-16-14-37(15-17-38)31(39)24-6-7-30(41-28-8-9-35-22-28)29(20-24)23-4-2-1-3-5-23;;/h6-7,18-21,23,28,34-35H,1-5,8-17,22H2;2*1H/t28-;;/m0../s1
Standard InChI Key: KTKFYLCCPOUIDU-ZXVJYWQYSA-N
Molfile:
RDKit 2D
43 46 0 0 0 0 0 0 0 0999 V2000
6.1607 1.3263 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0031 3.0008 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0351 3.6026 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.3039 3.7494 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 -3.0008 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3039 -3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.4469 -5.2297 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9152 -5.5365 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6607 -4.2349 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.6532 -3.1236 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3092 5.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6108 5.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9073 5.2404 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.9021 3.7404 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6005 2.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2112 5.9836 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5072 5.2269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2174 7.1836 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.8115 5.9678 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1053 5.2088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0949 3.7089 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7907 2.9679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.4969 3.7269 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7824 1.7679 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-10.4102 5.9502 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-10.4230 7.4502 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.7284 8.1891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-13.0210 7.4281 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-13.0082 5.9281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-11.7029 5.1892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8991 -0.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1969 -1.5046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1945 -3.0046 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8943 -3.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5964 -3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.6607 1.3263 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
6 7 2 0
7 2 1 0
4 8 1 0
8 9 2 0
8 10 1 0
7 11 1 0
12 11 1 6
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 12 1 0
10 17 1 0
10 21 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
19 22 1 0
22 23 1 0
22 24 2 0
23 25 2 0
25 26 1 0
26 27 2 0
27 28 1 0
28 29 2 0
29 23 1 0
28 30 1 0
31 32 1 0
31 36 1 0
32 33 1 0
33 34 1 0
34 35 1 0
35 36 1 0
26 31 1 0
37 38 1 0
37 42 1 0
38 39 1 0
39 40 1 0
40 41 1 0
41 42 1 0
6 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 563.72Molecular Weight (Monoisotopic): 563.3272AlogP: 3.62#Rotatable Bonds: 6Polar Surface Area: 77.15Molecular Species: BASEHBA: 6HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 10.31CX LogP: 3.46CX LogD: -0.72Aromatic Rings: 2Heavy Atoms: 41QED Weighted: 0.56Np Likeness Score: -0.86
References 1. Wisniewski JA, Yin J, Teuscher KB, Zhang M, Ji H.. (2016) Structure-Based Design of 1,4-Dibenzoylpiperazines as β-Catenin/B-Cell Lymphoma 9 Protein-Protein Interaction Inhibitors., 7 (5): [PMID:27190602 ] [10.1021/acsmedchemlett.5b00284 ] 2. Teuscher KB, Zhang M, Ji H.. (2017) A Versatile Method to Determine the Cellular Bioavailability of Small-Molecule Inhibitors., 60 (1): [PMID:27935314 ] [10.1021/acs.jmedchem.6b00923 ]