The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1,1-difluoro-2-methylpropan-2-yl 4-{5-[4-(methanesulfonyl)phenyl]-1H-pyrazolo[3,4-c]pyridin-1-yl}piperidine-1-carboxylate ID: ALA3822488
PubChem CID: 127048820
Max Phase: Preclinical
Molecular Formula: C23H26F2N4O4S
Molecular Weight: 492.55
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CC(C)(OC(=O)N1CCC(n2ncc3cc(-c4ccc(S(C)(=O)=O)cc4)ncc32)CC1)C(F)F
Standard InChI: InChI=1S/C23H26F2N4O4S/c1-23(2,21(24)25)33-22(30)28-10-8-17(9-11-28)29-20-14-26-19(12-16(20)13-27-29)15-4-6-18(7-5-15)34(3,31)32/h4-7,12-14,17,21H,8-11H2,1-3H3
Standard InChI Key: CYZKSRYMGPWAQR-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
-8.5582 3.1350 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-7.5199 3.7367 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-7.5222 4.9367 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0028 -1.5132 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3155 -0.7475 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 -0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2917 0.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 1.2033 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5889 0.0182 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.7138 -1.2033 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6168 1.4950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9144 0.7421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2151 1.4892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.2185 2.9892 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.9211 3.7421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.6204 2.9950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.1852 -2.6281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2781 -3.8165 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8565 -5.2005 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3443 -5.3916 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2537 -4.1987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6753 -2.8147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9258 -6.7752 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.4147 -6.9642 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.2000 -7.7307 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-8.5602 4.3348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9963 -8.3478 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4851 -8.5369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.9501 -9.6431 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8.2110 -7.5813 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
5.2704 -9.3034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8057 -8.1972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 2 2 0
4 5 2 0
5 9 1 0
8 6 1 0
6 7 2 0
7 4 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 8 1 0
13 14 2 0
14 15 1 0
15 16 2 0
16 17 1 0
17 18 2 0
18 13 1 0
4 13 1 0
19 20 1 0
19 24 1 0
20 21 1 0
21 22 1 0
22 23 1 0
23 24 1 0
12 19 1 0
22 25 1 0
25 26 1 0
25 27 2 0
16 2 1 0
2 28 1 0
26 29 1 0
29 30 1 0
30 31 1 0
30 32 1 0
29 33 1 0
29 34 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 492.55Molecular Weight (Monoisotopic): 492.1643AlogP: 4.32#Rotatable Bonds: 5Polar Surface Area: 94.39Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): ┄CX Acidic pKa: ┄CX Basic pKa: 1.97CX LogP: 2.11CX LogD: 2.11Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.53Np Likeness Score: -1.36
References 1. Matsuda D, Kobashi Y, Mikami A, Kawamura M, Shiozawa F, Kawabe K, Hamada M, Oda K, Nishimoto S, Kimura K, Miyoshi M, Takayama N, Kakinuma H, Ohtake N.. (2016) Design and synthesis of 1H-pyrazolo[3,4-c]pyridine derivatives as a novel structural class of potent GPR119 agonists., 26 (15): [PMID:27390068 ] [10.1016/j.bmcl.2016.06.050 ] 2. Matsuda D, Kobashi Y, Mikami A, Kawamura M, Shiozawa F, Kawabe K, Hamada M, Nishimoto S, Kimura K, Miyoshi M, Takayama N, Kakinuma H, Ohtake N.. (2017) Novel 3H-[1,2,3]triazolo[4,5-c]pyridine derivatives as GPR119 agonists: Synthesis and structure-activity/solubility relationships., 25 (16): [PMID:28662959 ] [10.1016/j.bmc.2017.06.014 ]