The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-[bis(3-methyl-5-oxo-1-phenyl-4,5-dihydro-4H-pyrazol-4-yl)methyl]-1-(2-deoxypentofuranosyl)pyrimidine-2,4(1H,3H)-dione ID: ALA382253
PubChem CID: 15954514
Max Phase: Preclinical
Molecular Formula: C30H30N6O7
Molecular Weight: 586.61
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC1=NN(c2ccccc2)C(=O)C1C(c1cn([C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)[nH]c1=O)C1C(=O)N(c2ccccc2)N=C1C
Standard InChI: InChI=1S/C30H30N6O7/c1-16-24(28(40)35(32-16)18-9-5-3-6-10-18)26(25-17(2)33-36(29(25)41)19-11-7-4-8-12-19)20-14-34(30(42)31-27(20)39)23-13-21(38)22(15-37)43-23/h3-12,14,21-26,37-38H,13,15H2,1-2H3,(H,31,39,42)/t21-,22+,23+,24?,25?,26?/m0/s1
Standard InChI Key: ZRNMENLOYXEZTM-XWESOOCRSA-N
Molfile:
RDKit 2D
43 48 0 0 1 0 0 0 0 0999 V2000
5.3108 -10.8195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1353 -10.8320 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.4087 -10.0524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.7480 -9.5535 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.0709 -10.0316 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.2057 -9.8403 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.2824 -9.7647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1189 -8.9499 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8169 -11.4859 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
7.7841 -10.4162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.5742 -10.2072 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
8.7843 -9.4055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.2187 -8.8383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4180 -9.0519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.5721 -11.2222 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.5824 -9.1674 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
8.4573 -8.0443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8366 -7.5043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.8231 -6.6861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0342 -6.4412 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.5750 -7.1087 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
7.0618 -7.7699 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.8245 -8.5668 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.7481 -7.0727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3596 -6.3435 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5340 -6.3110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0930 -7.0156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.4785 -7.7406 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3066 -7.7737 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2610 -7.8507 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9389 -8.3194 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5910 -7.8140 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
10.3179 -7.0432 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
9.4971 -7.0613 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.9958 -6.3925 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.9582 -9.1442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.8183 -6.3947 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.6373 -6.5059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.1417 -5.8542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.8179 -5.0868 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0063 -4.9799 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.5014 -5.6322 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4828 -6.1915 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19 20 2 0
20 21 1 0
21 22 1 0
22 18 1 0
1 2 1 0
22 23 2 0
3 6 1 1
21 24 1 0
24 25 2 0
6 14 1 0
25 26 1 0
10 11 1 0
26 27 2 0
11 12 1 0
27 28 1 0
12 13 1 0
28 29 2 0
29 24 1 0
13 14 2 0
17 30 1 0
30 31 1 0
5 7 1 1
10 15 2 0
3 2 1 0
12 16 2 0
31 32 2 0
32 33 1 0
33 34 1 0
34 30 1 0
7 8 1 0
34 35 2 0
13 17 1 0
31 36 1 0
3 4 1 0
33 37 1 0
17 18 1 0
37 38 2 0
18 19 1 0
38 39 1 0
1 9 1 6
39 40 2 0
6 10 1 0
40 41 1 0
4 5 1 0
41 42 2 0
42 37 1 0
5 1 1 0
19 43 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 586.61Molecular Weight (Monoisotopic): 586.2176AlogP: 1.34#Rotatable Bonds: 7Polar Surface Area: 169.89Molecular Species: NEUTRALHBA: 10HBD: 3#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 3#RO5 Violations (Lipinski): 2CX Acidic pKa: 9.64CX Basic pKa: ┄CX LogP: 1.05CX LogD: 1.04Aromatic Rings: 3Heavy Atoms: 43QED Weighted: 0.38Np Likeness Score: 0.01
References 1. Fan X, Zhang X, Zhou L, Keith KA, Kern ER, Torrence PF.. (2006) A pyrimidine-pyrazolone nucleoside chimera with potent in vitro anti-orthopoxvirus activity., 16 (12): [PMID:16603351 ] [10.1016/j.bmcl.2006.03.043 ] 2. Prichard MN, Keith KA, Johnson MP, Harden EA, McBrayer A, Luo M, Qiu S, Chattopadhyay D, Fan X, Torrence PF, Kern ER.. (2007) Selective phosphorylation of antiviral drugs by vaccinia virus thymidine kinase., 51 (5): [PMID:17325220 ] [10.1128/aac.01447-06 ]