The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1,3-(oxytetraethylenoxy)-1,3,5,5-tetrachlorocyclotriphosphazatriene ID: ALA382267
PubChem CID: 15203149
Max Phase: Preclinical
Molecular Formula: C8H16Cl4N3O5P3
Molecular Weight: 468.97
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: ClP1(Cl)=NP2(Cl)=NP(Cl)(=N1)OCCOCCOCCOCCO2
Standard InChI: InChI=1S/C8H16Cl4N3O5P3/c9-21(10)13-22(11)15-23(12,14-21)20-8-6-18-4-2-16-1-3-17-5-7-19-22/h1-8H2
Standard InChI Key: YXXZLWFIRYHKLU-UHFFFAOYSA-N
Molfile:
RDKit 2D
23 24 0 0 0 0 0 0 0 0999 V2000
-3.3061 1.7233 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.3079 0.8971 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
-2.5942 0.4830 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8779 0.8978 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
-1.8822 1.7246 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5969 2.1370 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0
-4.1118 0.5149 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.5393 -0.1961 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8339 -0.6174 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.4100 0.0898 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.4711 -0.7265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6674 -0.9166 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.4156 -0.1712 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.2208 -0.9711 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.4224 -0.7700 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6253 0.0268 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.0557 -0.5652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4667 0.0125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0418 0.6035 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.0127 2.7268 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-3.1862 2.7268 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-4.0296 1.3112 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-1.1651 1.3154 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4 5 1 0
5 6 2 0
6 1 1 0
2 7 1 0
7 8 1 0
8 9 1 0
9 10 1 0
10 11 1 0
11 12 1 0
12 13 1 0
13 14 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 4 1 0
6 20 1 0
1 2 2 0
6 21 1 0
2 3 1 0
2 22 1 0
3 4 2 0
4 23 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 468.97Molecular Weight (Monoisotopic): 466.9057AlogP: 5.89#Rotatable Bonds: ┄Polar Surface Area: 83.23Molecular Species: NEUTRALHBA: 8HBD: ┄#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 0.90CX LogP: 1.08CX LogD: 1.08Aromatic Rings: ┄Heavy Atoms: 23QED Weighted: 0.41Np Likeness Score: -0.23
References 1. Siwy M, Sek D, Kaczmarczyk B, Jaroszewicz I, Nasulewicz A, Pelczyñska M, Nevozhay D, Opolski A.. (2006) Synthesis and in vitro antileukemic activity of some new 1,3-(oxytetraethylenoxy)cyclotriphosphazene derivatives., 49 (2): [PMID:16420065 ] [10.1021/jm0490078 ]