The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-((5-Chloro-2-((2-methoxy-4-(4-(4-methylpiperazin-1-yl)-piperidin-1-yl)phenyl)amino)pyrimidin-4-yl)amino)-N,N-dimethylbenzamide ID: ALA3823016
PubChem CID: 127049149
Max Phase: Preclinical
Molecular Formula: C30H39ClN8O2
Molecular Weight: 579.15
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(N2CCC(N3CCN(C)CC3)CC2)ccc1Nc1ncc(Cl)c(Nc2ccccc2C(=O)N(C)C)n1
Standard InChI: InChI=1S/C30H39ClN8O2/c1-36(2)29(40)23-7-5-6-8-25(23)33-28-24(31)20-32-30(35-28)34-26-10-9-22(19-27(26)41-4)38-13-11-21(12-14-38)39-17-15-37(3)16-18-39/h5-10,19-21H,11-18H2,1-4H3,(H2,32,33,34,35)
Standard InChI Key: IHRFTDHYCNWNFR-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 3.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3039 3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3092 5.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6108 5.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9072 5.2405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9020 3.7405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6004 2.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8915 -3.7585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8864 -5.2585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5847 -6.0040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2883 -5.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2935 -3.7495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5795 -7.5047 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8748 -8.2614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8672 -9.7614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5644 -10.5048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2692 -9.7483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2767 -8.2483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5568 -12.0055 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8509 -12.7642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8409 -14.2642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5370 -15.0056 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2429 -14.2470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2529 -12.7470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5290 -16.2056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1954 -3.0153 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2317 -3.6204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3383 1.3500 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
0.0136 6.0070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0288 5.4125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0210 7.5078 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.0149 8.1136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0633 8.1024 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
1 6 2 0
1 7 1 0
3 8 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
9 14 2 0
8 9 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
15 20 2 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
21 26 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
27 32 1 0
30 33 1 0
24 27 1 0
18 21 1 0
34 35 1 0
16 34 1 0
7 15 1 0
4 36 1 0
10 37 1 0
37 38 2 0
37 39 1 0
39 40 1 0
39 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 579.15Molecular Weight (Monoisotopic): 578.2885AlogP: 4.54#Rotatable Bonds: 8Polar Surface Area: 89.10Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 10HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 12.88CX Basic pKa: 8.48CX LogP: 5.23CX LogD: 4.06Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.40Np Likeness Score: -1.63
References 1. Huang WS, Liu S, Zou D, Thomas M, Wang Y, Zhou T, Romero J, Kohlmann A, Li F, Qi J, Cai L, Dwight TA, Xu Y, Xu R, Dodd R, Toms A, Parillon L, Lu X, Anjum R, Zhang S, Wang F, Keats J, Wardwell SD, Ning Y, Xu Q, Moran LE, Mohemmad QK, Jang HG, Clackson T, Narasimhan NI, Rivera VM, Zhu X, Dalgarno D, Shakespeare WC.. (2016) Discovery of Brigatinib (AP26113), a Phosphine Oxide-Containing, Potent, Orally Active Inhibitor of Anaplastic Lymphoma Kinase., 59 (10): [PMID:27144831 ] [10.1021/acs.jmedchem.6b00306 ]