5-chloro-N2-(2-methoxy-4-(4-(4-methylpiperazin-1-yl)piperidin-1-yl)phenyl)-N4-(2-methoxyphenyl)pyrimidine-2,4-diamine

ID: ALA3823045

PubChem CID: 89773146

Max Phase: Preclinical

Molecular Formula: C28H36ClN7O2

Molecular Weight: 538.10

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  COc1cc(N2CCC(N3CCN(C)CC3)CC2)ccc1Nc1ncc(Cl)c(Nc2ccccc2OC)n1

Standard InChI:  InChI=1S/C28H36ClN7O2/c1-34-14-16-36(17-15-34)20-10-12-35(13-11-20)21-8-9-24(26(18-21)38-3)32-28-30-19-22(29)27(33-28)31-23-6-4-5-7-25(23)37-2/h4-9,18-20H,10-17H2,1-3H3,(H2,30,31,32,33)

Standard InChI Key:  DRYWSMFQHZVTJK-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 38 42  0  0  0  0  0  0  0  0999 V2000
    1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2990    0.7500    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990    0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2990   -0.7500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   -1.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5973   -1.5031    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0031    3.0008    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.3039    3.7494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3092    5.2494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6108    5.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9072    5.2405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9020    3.7405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6004    2.9949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5951   -3.0039    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8915   -3.7585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8864   -5.2585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5847   -6.0040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2883   -5.2495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2935   -3.7495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5795   -7.5047    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8748   -8.2614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8672   -9.7614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5644  -10.5048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2692   -9.7483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2767   -8.2483    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5568  -12.0055    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.8509  -12.7642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8409  -14.2642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5370  -15.0056    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2429  -14.2470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2529  -12.7470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5290  -16.2056    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1954   -3.0153    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2317   -3.6204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3383    1.3500    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    0.0136    6.0070    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0195    7.2070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  2  0
  5  6  1  0
  1  6  2  0
  1  7  1  0
  3  8  1  0
  9 10  1  0
 10 11  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
  9 14  2  0
  8  9  1  0
 15 16  1  0
 16 17  2  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 15 20  2  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 21 26  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 27 32  1  0
 30 33  1  0
 24 27  1  0
 18 21  1  0
 34 35  1  0
 16 34  1  0
  7 15  1  0
  4 36  1  0
 37 38  1  0
 10 37  1  0
M  END

Associated Targets(Human)

INSR Tclin Insulin receptor (5558 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
IGF1R Tclin Insulin-like growth factor I receptor (8605 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
ALK Tclin ALK tyrosine kinase receptor (7132 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 538.10Molecular Weight (Monoisotopic): 537.2619AlogP: 4.85#Rotatable Bonds: 8
Polar Surface Area: 78.02Molecular Species: NEUTRALHBA: 9HBD: 2
#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.90CX Basic pKa: 8.48CX LogP: 4.47CX LogD: 3.31
Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.42Np Likeness Score: -1.42

References

1. Huang WS, Liu S, Zou D, Thomas M, Wang Y, Zhou T, Romero J, Kohlmann A, Li F, Qi J, Cai L, Dwight TA, Xu Y, Xu R, Dodd R, Toms A, Parillon L, Lu X, Anjum R, Zhang S, Wang F, Keats J, Wardwell SD, Ning Y, Xu Q, Moran LE, Mohemmad QK, Jang HG, Clackson T, Narasimhan NI, Rivera VM, Zhu X, Dalgarno D, Shakespeare WC..  (2016)  Discovery of Brigatinib (AP26113), a Phosphine Oxide-Containing, Potent, Orally Active Inhibitor of Anaplastic Lymphoma Kinase.,  59  (10): [PMID:27144831] [10.1021/acs.jmedchem.6b00306]

Source