The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-chloro-N2-(2-methoxy-4-(4-(4-methylpiperazin-1-yl)piperidin-1-yl)phenyl)-N4-(2-methoxyphenyl)pyrimidine-2,4-diamine ID: ALA3823045
PubChem CID: 89773146
Max Phase: Preclinical
Molecular Formula: C28H36ClN7O2
Molecular Weight: 538.10
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(N2CCC(N3CCN(C)CC3)CC2)ccc1Nc1ncc(Cl)c(Nc2ccccc2OC)n1
Standard InChI: InChI=1S/C28H36ClN7O2/c1-34-14-16-36(17-15-34)20-10-12-35(13-11-20)21-8-9-24(26(18-21)38-3)32-28-30-19-22(29)27(33-28)31-23-6-4-5-7-25(23)37-2/h4-9,18-20H,10-17H2,1-3H3,(H2,30,31,32,33)
Standard InChI Key: DRYWSMFQHZVTJK-UHFFFAOYSA-N
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 3.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3039 3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3092 5.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6108 5.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9072 5.2405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9020 3.7405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6004 2.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8915 -3.7585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8864 -5.2585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5847 -6.0040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2883 -5.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2935 -3.7495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5795 -7.5047 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8748 -8.2614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8672 -9.7614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5644 -10.5048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2692 -9.7483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2767 -8.2483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5568 -12.0055 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8509 -12.7642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8409 -14.2642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5370 -15.0056 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2429 -14.2470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2529 -12.7470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5290 -16.2056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1954 -3.0153 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2317 -3.6204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3383 1.3500 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
0.0136 6.0070 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0195 7.2070 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
1 6 2 0
1 7 1 0
3 8 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
9 14 2 0
8 9 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
15 20 2 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
21 26 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
27 32 1 0
30 33 1 0
24 27 1 0
18 21 1 0
34 35 1 0
16 34 1 0
7 15 1 0
4 36 1 0
37 38 1 0
10 37 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 538.10Molecular Weight (Monoisotopic): 537.2619AlogP: 4.85#Rotatable Bonds: 8Polar Surface Area: 78.02Molecular Species: NEUTRALHBA: 9HBD: 2#RO5 Violations: 1HBA (Lipinski): 9HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.90CX Basic pKa: 8.48CX LogP: 4.47CX LogD: 3.31Aromatic Rings: 3Heavy Atoms: 38QED Weighted: 0.42Np Likeness Score: -1.42
References 1. Huang WS, Liu S, Zou D, Thomas M, Wang Y, Zhou T, Romero J, Kohlmann A, Li F, Qi J, Cai L, Dwight TA, Xu Y, Xu R, Dodd R, Toms A, Parillon L, Lu X, Anjum R, Zhang S, Wang F, Keats J, Wardwell SD, Ning Y, Xu Q, Moran LE, Mohemmad QK, Jang HG, Clackson T, Narasimhan NI, Rivera VM, Zhu X, Dalgarno D, Shakespeare WC.. (2016) Discovery of Brigatinib (AP26113), a Phosphine Oxide-Containing, Potent, Orally Active Inhibitor of Anaplastic Lymphoma Kinase., 59 (10): [PMID:27144831 ] [10.1021/acs.jmedchem.6b00306 ]