The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-Chloro-N2-(2-methoxy-4-(4-(4-methylpiperazin-1-yl)piperidin-1-yl)phenyl)-N4-phenylpyrimidine-2,4-diamine ID: ALA3824185
PubChem CID: 127052979
Max Phase: Preclinical
Molecular Formula: C27H34ClN7O
Molecular Weight: 508.07
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: COc1cc(N2CCC(N3CCN(C)CC3)CC2)ccc1Nc1ncc(Cl)c(Nc2ccccc2)n1
Standard InChI: InChI=1S/C27H34ClN7O/c1-33-14-16-35(17-15-33)21-10-12-34(13-11-21)22-8-9-24(25(18-22)36-2)31-27-29-19-23(28)26(32-27)30-20-6-4-3-5-7-20/h3-9,18-19,21H,10-17H2,1-2H3,(H2,29,30,31,32)
Standard InChI Key: DEBFWFAAIWZWSH-UHFFFAOYSA-N
Molfile:
RDKit 2D
36 40 0 0 0 0 0 0 0 0999 V2000
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
2.5973 -1.5031 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.0031 3.0008 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.3039 3.7494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3092 5.2494 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6108 5.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9072 5.2405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.9020 3.7405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6004 2.9949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5951 -3.0039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8915 -3.7585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8864 -5.2585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5847 -6.0040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2883 -5.2495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2935 -3.7495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5795 -7.5047 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8748 -8.2614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8672 -9.7614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5644 -10.5048 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2692 -9.7483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2767 -8.2483 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5568 -12.0055 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8509 -12.7642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8409 -14.2642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5370 -15.0056 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.2429 -14.2470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2529 -12.7470 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5290 -16.2056 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1954 -3.0153 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2317 -3.6204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3383 1.3500 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
3 4 1 0
4 5 2 0
5 6 1 0
1 6 2 0
1 7 1 0
3 8 1 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
9 14 2 0
8 9 1 0
15 16 1 0
16 17 2 0
17 18 1 0
18 19 2 0
19 20 1 0
15 20 2 0
21 22 1 0
22 23 1 0
23 24 1 0
24 25 1 0
25 26 1 0
21 26 1 0
27 28 1 0
28 29 1 0
29 30 1 0
30 31 1 0
31 32 1 0
27 32 1 0
30 33 1 0
24 27 1 0
18 21 1 0
34 35 1 0
16 34 1 0
7 15 1 0
4 36 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 508.07Molecular Weight (Monoisotopic): 507.2513AlogP: 4.84#Rotatable Bonds: 7Polar Surface Area: 68.79Molecular Species: BASEHBA: 8HBD: 2#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.54CX LogP: 4.63CX LogD: 3.47Aromatic Rings: 3Heavy Atoms: 36QED Weighted: 0.47Np Likeness Score: -1.49
References 1. Huang WS, Liu S, Zou D, Thomas M, Wang Y, Zhou T, Romero J, Kohlmann A, Li F, Qi J, Cai L, Dwight TA, Xu Y, Xu R, Dodd R, Toms A, Parillon L, Lu X, Anjum R, Zhang S, Wang F, Keats J, Wardwell SD, Ning Y, Xu Q, Moran LE, Mohemmad QK, Jang HG, Clackson T, Narasimhan NI, Rivera VM, Zhu X, Dalgarno D, Shakespeare WC.. (2016) Discovery of Brigatinib (AP26113), a Phosphine Oxide-Containing, Potent, Orally Active Inhibitor of Anaplastic Lymphoma Kinase., 59 (10): [PMID:27144831 ] [10.1021/acs.jmedchem.6b00306 ]