The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(2S)-5-oxo-2-[(biphenylsulfonyl)amino]-5-[2-(phenylethylamino)]pentanoic acid ID: ALA3828051
PubChem CID: 127044036
Max Phase: Preclinical
Molecular Formula: C25H26N2O5S
Molecular Weight: 466.56
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(CC[C@H](NS(=O)(=O)c1ccc(-c2ccccc2)cc1)C(=O)O)NCCc1ccccc1
Standard InChI: InChI=1S/C25H26N2O5S/c28-24(26-18-17-19-7-3-1-4-8-19)16-15-23(25(29)30)27-33(31,32)22-13-11-21(12-14-22)20-9-5-2-6-10-20/h1-14,23,27H,15-18H2,(H,26,28)(H,29,30)/t23-/m0/s1
Standard InChI Key: ZWFVIZGPXNSREN-QHCPKHFHSA-N
Molfile:
RDKit 2D
33 35 0 0 0 0 0 0 0 0999 V2000
-5.1975 2.9981 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8995 3.7516 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9005 5.2525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2002 6.0029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.2012 7.5037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1954 1.7981 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.2380 3.5960 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-4.1621 8.1040 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5998 3.0012 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.5988 1.5004 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2990 -0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 -1.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5987 -1.5004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8991 -0.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1969 -1.5045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.1945 -3.0045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8943 -3.7525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5965 -3.0004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5009 8.2541 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-3.6383 2.0999 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.6378 0.9001 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-6.5019 9.7549 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8017 10.5053 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.8026 12.0061 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.1006 12.7581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-9.0985 14.2581 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-7.7984 15.0062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5004 14.2544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-6.5025 12.7544 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
1 6 2 0
1 7 1 0
5 8 2 0
11 12 1 0
12 13 2 0
13 14 1 0
14 15 2 0
15 16 1 0
11 16 2 0
17 18 1 0
18 19 2 0
19 20 1 0
20 21 2 0
21 22 1 0
17 22 2 0
11 17 1 0
10 14 1 0
9 10 1 0
2 9 1 6
5 23 1 0
10 24 2 0
10 25 2 0
23 26 1 0
26 27 1 0
27 28 1 0
28 29 2 0
29 30 1 0
30 31 2 0
31 32 1 0
32 33 2 0
33 28 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 466.56Molecular Weight (Monoisotopic): 466.1562AlogP: 3.22#Rotatable Bonds: 11Polar Surface Area: 112.57Molecular Species: ACIDHBA: 4HBD: 3#RO5 Violations: ┄HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): ┄CX Acidic pKa: 3.33CX Basic pKa: ┄CX LogP: 3.57CX LogD: 0.15Aromatic Rings: 3Heavy Atoms: 33QED Weighted: 0.40Np Likeness Score: -0.67
References 1. Adhikari N, Halder AK, Mallick S, Saha A, Saha KD, Jha T.. (2016) Robust design of some selective matrix metalloproteinase-2 inhibitors over matrix metalloproteinase-9 through in silico/fragment-based lead identification and de novo lead modification: Syntheses and biological assays., 24 (18): [PMID:27452283 ] [10.1016/j.bmc.2016.07.023 ]