2-chloro-N-(2-(1-(4-fluorophenyl)-1H-pyrazol-4-yl)-1H-benzo[d]imidazol-5-yl)benzamide

ID: ALA384066

PubChem CID: 44416582

Max Phase: Preclinical

Molecular Formula: C23H15ClFN5O

Molecular Weight: 431.86

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc2[nH]c(-c3cnn(-c4ccc(F)cc4)c3)nc2c1)c1ccccc1Cl

Standard InChI:  InChI=1S/C23H15ClFN5O/c24-19-4-2-1-3-18(19)23(31)27-16-7-10-20-21(11-16)29-22(28-20)14-12-26-30(13-14)17-8-5-15(25)6-9-17/h1-13H,(H,27,31)(H,28,29)

Standard InChI Key:  PEUHOGMONYOJND-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 31 35  0  0  0  0  0  0  0  0999 V2000
    5.8365   -0.6250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8353   -1.4524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5501   -1.8653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2667   -1.4520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2638   -0.6213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5483   -0.2122    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9818   -1.8633    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9831   -2.6884    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6957   -1.4497    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.4108   -1.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4074   -2.6846    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1218   -3.0959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1178   -1.4453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6168   -1.5925    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.8327   -1.8529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8392   -2.6798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6283   -2.9277    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.1067   -2.2533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9316   -2.2446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5499   -2.6904    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   13.4196   -2.9100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2025   -2.6467    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.1921   -1.8209    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.4036   -1.5761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.9026   -1.4014    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.6197   -1.8075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3296   -1.3887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3219   -0.5627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.5982   -0.1575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8913   -0.5788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0317   -0.1422    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  4  7  1  0
  3  4  1  0
  7  8  2  0
 14 15  1  0
 16 17  1  0
 17 18  1  0
 18 14  2  0
  7  9  1  0
 18 19  1  0
  4  5  2  0
  3 20  1  0
 21 22  2  0
  9 10  1  0
  2  3  2  0
 10 11  2  0
  5  6  1  0
 19 21  1  0
 22 23  1  0
 23 24  1  0
 24 19  2  0
 11 12  1  0
 23 25  1  0
 12 16  2  0
 25 26  2  0
  6  1  2  0
 26 27  1  0
 15 13  2  0
 27 28  2  0
 13 10  1  0
 28 29  1  0
 15 16  1  0
 29 30  2  0
 30 25  1  0
  1  2  1  0
 28 31  1  0
M  END

Associated Targets(Human)

NR2E3 Tchem Photoreceptor-specific nuclear receptor (502 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 431.86Molecular Weight (Monoisotopic): 431.0949AlogP: 5.46#Rotatable Bonds: 4
Polar Surface Area: 75.60Molecular Species: NEUTRALHBA: 4HBD: 2
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 2#RO5 Violations (Lipinski): 1
CX Acidic pKa: 10.99CX Basic pKa: 4.71CX LogP: 5.21CX LogD: 5.21
Aromatic Rings: 5Heavy Atoms: 31QED Weighted: 0.40Np Likeness Score: -2.44

References

1. Wolkenberg SE, Zhao Z, Kapitskaya M, Webber AL, Petrukhin K, Tang YS, Dean DC, Hartman GD, Lindsley CW..  (2006)  Identification of potent agonists of photoreceptor-specific nuclear receptor (NR2E3) and preparation of a radioligand.,  16  (19): [PMID:16879962] [10.1016/j.bmcl.2006.07.056]

Source