2-chloro-N-(4-(5-(2-chlorobenzamido)-1H-benzo[d]imidazol-2-yl)phenyl)nicotinamide

ID: ALA384232

PubChem CID: 44416476

Max Phase: Preclinical

Molecular Formula: C26H17Cl2N5O2

Molecular Weight: 502.36

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc2[nH]c(-c3ccc(NC(=O)c4cccnc4Cl)cc3)nc2c1)c1ccccc1Cl

Standard InChI:  InChI=1S/C26H17Cl2N5O2/c27-20-6-2-1-4-18(20)25(34)31-17-11-12-21-22(14-17)33-24(32-21)15-7-9-16(10-8-15)30-26(35)19-5-3-13-29-23(19)28/h1-14H,(H,30,35)(H,31,34)(H,32,33)

Standard InChI Key:  YWJAPPQRDYDOGQ-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
    6.3411   -1.2291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9394   -1.9495    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3639   -2.6569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1903   -2.6431    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.5905   -1.9160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1638   -1.2117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5614   -0.4880    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1551    0.2185    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3980   -0.4891    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4160   -1.8989    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    4.6795    0.2666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0808   -0.4541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9057   -0.4659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3292    0.2439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9220    0.9671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0985    0.9754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8539    0.2773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4212    1.9069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4224    1.0788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7070    0.6655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9899    1.0793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9928    1.9105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7088    2.3199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2742    0.6675    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2729   -0.1582    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4402    1.0815    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1559    0.6697    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1525   -0.1544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8674   -0.5660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8634    1.0859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3636    0.9387    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5789    0.6781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5854   -0.1494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3751   -0.3977    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7072   -0.1602    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  6  1  1  0
  1  2  2  0
  6  7  1  0
  3  4  2  0
  8  7  1  0
  4  5  1  0
  7  9  2  0
  5 10  1  0
  2  3  1  0
  5  6  2  0
 11 12  2  0
 20 21  1  0
 21 22  2  0
 12 13  1  0
 22 23  1  0
 23 18  2  0
 21 24  1  0
 13 14  2  0
 24 25  2  0
 24 26  1  0
 14 15  1  0
 26 27  1  0
 27 28  2  0
 15 16  2  0
 28 29  1  0
 29 33  2  0
 16 11  1  0
 32 30  2  0
 30 27  1  0
 32 33  1  0
 11 17  1  0
 31 32  1  0
 33 34  1  0
 34 17  1  0
 17 31  2  0
 18 19  1  0
 20 35  1  0
 19 20  2  0
 14  8  1  0
M  END

Associated Targets(Human)

NR2E3 Tchem Photoreceptor-specific nuclear receptor (502 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 502.36Molecular Weight (Monoisotopic): 501.0759AlogP: 6.44#Rotatable Bonds: 5
Polar Surface Area: 99.77Molecular Species: NEUTRALHBA: 4HBD: 3
#RO5 Violations: 2HBA (Lipinski): 7HBD (Lipinski): 3#RO5 Violations (Lipinski): 2
CX Acidic pKa: 11.54CX Basic pKa: 5.14CX LogP: 5.68CX LogD: 5.68
Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.24Np Likeness Score: -1.62

References

1. Wolkenberg SE, Zhao Z, Kapitskaya M, Webber AL, Petrukhin K, Tang YS, Dean DC, Hartman GD, Lindsley CW..  (2006)  Identification of potent agonists of photoreceptor-specific nuclear receptor (NR2E3) and preparation of a radioligand.,  16  (19): [PMID:16879962] [10.1016/j.bmcl.2006.07.056]

Source