The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
2-chloro-N-(2-{4-[(2-fluorobenzene)amido]phenyl}-1H-1,3-benzodiazol-5-yl)benzamide ID: ALA384623
PubChem CID: 44416605
Max Phase: Preclinical
Molecular Formula: C27H18ClFN4O2
Molecular Weight: 484.92
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: O=C(Nc1ccc(-c2nc3cc(NC(=O)c4ccccc4Cl)ccc3[nH]2)cc1)c1ccccc1F
Standard InChI: InChI=1S/C27H18ClFN4O2/c28-21-7-3-1-5-19(21)26(34)31-18-13-14-23-24(15-18)33-25(32-23)16-9-11-17(12-10-16)30-27(35)20-6-2-4-8-22(20)29/h1-15H,(H,30,35)(H,31,34)(H,32,33)
Standard InChI Key: PGEMDJKAVJEXMB-UHFFFAOYSA-N
Molfile:
RDKit 2D
35 39 0 0 0 0 0 0 0 0999 V2000
1.1934 -12.7646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5943 -13.4848 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4186 -13.4966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8418 -12.7873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4349 -12.0648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6120 -12.0565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3684 -12.7540 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.9018 -11.1257 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.9030 -11.9531 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1881 -12.3660 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4716 -11.9527 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.4745 -11.1220 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-5.1899 -10.7129 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7564 -12.3640 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.7551 -13.1891 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.0426 -11.9504 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.3275 -12.3618 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.3309 -13.1853 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6165 -13.5966 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6205 -11.9460 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1215 -12.0932 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.9056 -12.3536 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8991 -13.1805 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1100 -13.4284 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-5.1883 -13.1911 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
3.6667 -12.7977 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0703 -13.5175 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8952 -13.5278 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6487 -14.2267 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.2966 -14.2476 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1209 -14.2584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.5432 -13.5486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.1353 -12.8265 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3124 -12.8193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.9061 -12.1013 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
8 9 2 0
17 18 2 0
4 5 2 0
18 19 1 0
19 23 2 0
9 10 1 0
22 20 2 0
20 17 1 0
22 23 1 0
2 3 2 0
10 11 2 0
5 6 1 0
11 12 1 0
21 22 1 0
23 24 1 0
24 7 1 0
7 21 2 0
6 1 2 0
10 25 1 0
12 13 2 0
4 26 1 0
13 8 1 0
26 27 1 0
1 2 1 0
27 28 1 0
11 14 1 0
27 29 2 0
1 7 1 0
28 30 2 0
14 15 2 0
30 31 1 0
3 4 1 0
31 32 2 0
14 16 1 0
32 33 1 0
33 34 2 0
34 28 1 0
16 17 1 0
34 35 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 484.92Molecular Weight (Monoisotopic): 484.1102AlogP: 6.53#Rotatable Bonds: 5Polar Surface Area: 86.88Molecular Species: NEUTRALHBA: 3HBD: 3#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1CX Acidic pKa: 11.54CX Basic pKa: 5.14CX LogP: 6.21CX LogD: 6.21Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.26Np Likeness Score: -1.71
References 1. Wolkenberg SE, Zhao Z, Kapitskaya M, Webber AL, Petrukhin K, Tang YS, Dean DC, Hartman GD, Lindsley CW.. (2006) Identification of potent agonists of photoreceptor-specific nuclear receptor (NR2E3) and preparation of a radioligand., 16 (19): [PMID:16879962 ] [10.1016/j.bmcl.2006.07.056 ]