2-chloro-N-(2-{4-[(2-fluorobenzene)amido]phenyl}-1H-1,3-benzodiazol-5-yl)benzamide

ID: ALA384623

PubChem CID: 44416605

Max Phase: Preclinical

Molecular Formula: C27H18ClFN4O2

Molecular Weight: 484.92

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  O=C(Nc1ccc(-c2nc3cc(NC(=O)c4ccccc4Cl)ccc3[nH]2)cc1)c1ccccc1F

Standard InChI:  InChI=1S/C27H18ClFN4O2/c28-21-7-3-1-5-19(21)26(34)31-18-13-14-23-24(15-18)33-25(32-23)16-9-11-17(12-10-16)30-27(35)20-6-2-4-8-22(20)29/h1-15H,(H,30,35)(H,31,34)(H,32,33)

Standard InChI Key:  PGEMDJKAVJEXMB-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 35 39  0  0  0  0  0  0  0  0999 V2000
    1.1934  -12.7646    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5943  -13.4848    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4186  -13.4966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8418  -12.7873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4349  -12.0648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6120  -12.0565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3684  -12.7540    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9018  -11.1257    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9030  -11.9531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1881  -12.3660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4716  -11.9527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4745  -11.1220    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1899  -10.7129    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7564  -12.3640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7551  -13.1891    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0426  -11.9504    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3275  -12.3618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3309  -13.1853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6165  -13.5966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6205  -11.9460    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1215  -12.0932    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9056  -12.3536    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8991  -13.1805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1100  -13.4284    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1883  -13.1911    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.6667  -12.7977    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0703  -13.5175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8952  -13.5278    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6487  -14.2267    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2966  -14.2476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1209  -14.2584    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5432  -13.5486    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1353  -12.8265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3124  -12.8193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9061  -12.1013    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  8  9  2  0
 17 18  2  0
  4  5  2  0
 18 19  1  0
 19 23  2  0
  9 10  1  0
 22 20  2  0
 20 17  1  0
 22 23  1  0
  2  3  2  0
 10 11  2  0
  5  6  1  0
 11 12  1  0
 21 22  1  0
 23 24  1  0
 24  7  1  0
  7 21  2  0
  6  1  2  0
 10 25  1  0
 12 13  2  0
  4 26  1  0
 13  8  1  0
 26 27  1  0
  1  2  1  0
 27 28  1  0
 11 14  1  0
 27 29  2  0
  1  7  1  0
 28 30  2  0
 14 15  2  0
 30 31  1  0
  3  4  1  0
 31 32  2  0
 14 16  1  0
 32 33  1  0
 33 34  2  0
 34 28  1  0
 16 17  1  0
 34 35  1  0
M  END

Associated Targets(Human)

NR2E3 Tchem Photoreceptor-specific nuclear receptor (502 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 484.92Molecular Weight (Monoisotopic): 484.1102AlogP: 6.53#Rotatable Bonds: 5
Polar Surface Area: 86.88Molecular Species: NEUTRALHBA: 3HBD: 3
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.54CX Basic pKa: 5.14CX LogP: 6.21CX LogD: 6.21
Aromatic Rings: 5Heavy Atoms: 35QED Weighted: 0.26Np Likeness Score: -1.71

References

1. Wolkenberg SE, Zhao Z, Kapitskaya M, Webber AL, Petrukhin K, Tang YS, Dean DC, Hartman GD, Lindsley CW..  (2006)  Identification of potent agonists of photoreceptor-specific nuclear receptor (NR2E3) and preparation of a radioligand.,  16  (19): [PMID:16879962] [10.1016/j.bmcl.2006.07.056]

Source