The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
SID124949964 ID: ALA3856075
PubChem CID: 42424017
Max Phase: Preclinical
Molecular Formula: C24H28N4O5S
Molecular Weight: 484.58
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: COc1ccc(-c2ccc(C(=O)N3CCc4c(cnc(C)c4CNS(=O)(=O)N(C)C)C3)o2)cc1
Standard InChI: InChI=1S/C24H28N4O5S/c1-16-21(14-26-34(30,31)27(2)3)20-11-12-28(15-18(20)13-25-16)24(29)23-10-9-22(33-23)17-5-7-19(32-4)8-6-17/h5-10,13,26H,11-12,14-15H2,1-4H3
Standard InChI Key: KYTPDWBEMISAFA-UHFFFAOYSA-N
Molfile:
RDKit 2D
34 37 0 0 0 0 0 0 0 0999 V2000
18.9984 3.7870 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
7.7567 4.9292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
9.2484 7.6841 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.6390 3.1531 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
19.5115 2.3774 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.9635 1.0216 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
11.4984 6.3851 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.9984 8.9831 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.2484 5.0860 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
20.4473 4.1752 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.4984 6.3851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7484 7.6841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.9984 6.3851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.9984 6.3851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.2484 5.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2484 7.6841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7484 7.6841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
13.7485 5.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
12.2485 5.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4448 3.4620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.4984 8.9831 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.7484 5.0860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8586 3.7157 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0745 2.8519 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.7438 2.7120 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9177 1.3601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8610 3.7336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.2484 7.6841 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3338 1.6317 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5474 0.7500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4906 3.1235 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.5080 3.1146 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.8356 5.6241 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7500 1.9032 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 4 2 0
1 5 2 0
1 9 1 0
1 10 1 0
2 15 1 0
2 20 1 0
3 14 2 0
6 29 1 0
6 34 1 0
7 14 1 0
7 16 1 0
7 19 1 0
8 17 1 0
8 21 2 0
9 22 1 0
10 32 1 0
10 33 1 0
11 12 2 0
11 13 1 0
11 18 1 0
12 16 1 0
12 21 1 0
13 17 2 0
13 22 1 0
14 15 1 0
15 23 2 0
17 28 1 0
18 19 1 0
20 24 1 0
20 25 2 0
23 25 1 0
24 26 2 0
24 27 1 0
26 30 1 0
27 31 2 0
29 30 2 0
29 31 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 484.58Molecular Weight (Monoisotopic): 484.1780AlogP: 2.75#Rotatable Bonds: 7Polar Surface Area: 104.98Molecular Species: NEUTRALHBA: 6HBD: 1#RO5 Violations: ┄HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): ┄CX Acidic pKa: 10.87CX Basic pKa: 5.20CX LogP: 0.85CX LogD: 0.85Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.55Np Likeness Score: -1.47
References 1. PubChem BioAssay data set,