7-benzo[1,3]dioxol-5-ylmethyl-4,9-dimethyl-2-phenyl-7H-3,3a,5,7,8-pentaaza-cyclopenta[a]naphthalen-6-one

ID: ALA385683

PubChem CID: 11850147

Max Phase: Preclinical

Molecular Formula: C24H19N5O3

Molecular Weight: 425.45

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1nn(Cc2ccc3c(c2)OCO3)c(=O)c2nc(C)n3nc(-c4ccccc4)cc3c12

Standard InChI:  InChI=1S/C24H19N5O3/c1-14-22-19-11-18(17-6-4-3-5-7-17)27-29(19)15(2)25-23(22)24(30)28(26-14)12-16-8-9-20-21(10-16)32-13-31-20/h3-11H,12-13H2,1-2H3

Standard InChI Key:  ZEAOAEIMQPOFMV-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 37  0  0  0  0  0  0  0  0999 V2000
   -3.0650   -9.8915    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5061   -9.1948    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1148   -8.4688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2884   -8.4424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9002   -7.7175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3340   -7.0142    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1605   -7.0407    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5532   -7.7703    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3778   -7.7979    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8569   -9.1371    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2391   -9.8616    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6682  -10.4490    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9330  -10.0876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0498   -9.2767    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2033  -10.4725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1736  -11.2946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5553  -11.6796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2545  -11.2399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2202  -10.4113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4908  -10.0301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0755   -7.6922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4498  -10.6215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5950   -6.3393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2048   -5.6123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3790   -5.5917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2523   -4.1916    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6387   -4.9182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4234   -4.1632    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9881   -4.8652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1859   -4.6682    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1254   -3.8443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8903   -3.5323    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
 13 15  1  0
  4  5  1  0
 15 16  2  0
  5  6  2  0
 16 17  1  0
  6  7  1  0
 17 18  2  0
  7  8  1  0
 18 19  1  0
 19 20  2  0
 20 15  1  0
  8  9  2  0
  5 21  1  0
 10 11  1  0
  1 22  1  0
  1 11  1  0
  7 23  1  0
  1  2  2  0
 23 24  1  0
 10  4  1  0
 24 25  2  0
 25 29  1  0
  3  2  1  0
 28 26  1  0
  3  4  2  0
 26 27  2  0
 27 24  1  0
 28 29  2  0
 11 12  1  0
 12 13  2  0
 13 14  1  0
 14 10  2  0
  3  8  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 28  1  0
M  END

Associated Targets(Human)

PDE6H Tclin Phosphodiesterase 6 (167 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
PDE5A Tclin Phosphodiesterase 5A (5113 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 425.45Molecular Weight (Monoisotopic): 425.1488AlogP: 3.50#Rotatable Bonds: 3
Polar Surface Area: 83.54Molecular Species: NEUTRALHBA: 8HBD:
#RO5 Violations: HBA (Lipinski): 8HBD (Lipinski): #RO5 Violations (Lipinski):
CX Acidic pKa: CX Basic pKa: CX LogP: 3.28CX LogD: 3.28
Aromatic Rings: 5Heavy Atoms: 32QED Weighted: 0.44Np Likeness Score: -1.41

References

1. Giovannoni MP, Vergelli C, Biancalani C, Cesari N, Graziano A, Biagini P, Gracia J, Gavaldà A, Dal Piaz V..  (2006)  Novel pyrazolopyrimidopyridazinones with potent and selective phosphodiesterase 5 (PDE5) inhibitory activity as potential agents for treatment of erectile dysfunction.,  49  (17): [PMID:16913726] [10.1021/jm060265+]

Source