2-chloro-N-(4-(5-(1-methylcyclopropanecarboxamido)-1H-benzo[d]imidazol-2-yl)phenyl)benzamide

ID: ALA385936

PubChem CID: 44416478

Max Phase: Preclinical

Molecular Formula: C25H21ClN4O2

Molecular Weight: 444.92

Molecule Type: Small molecule

Associated Items:

This compound is not in our inventory system

Names and Identifiers

Canonical SMILES:  CC1(C(=O)Nc2ccc3[nH]c(-c4ccc(NC(=O)c5ccccc5Cl)cc4)nc3c2)CC1

Standard InChI:  InChI=1S/C25H21ClN4O2/c1-25(12-13-25)24(32)28-17-10-11-20-21(14-17)30-22(29-20)15-6-8-16(9-7-15)27-23(31)18-4-2-3-5-19(18)26/h2-11,14H,12-13H2,1H3,(H,27,31)(H,28,32)(H,29,30)

Standard InChI Key:  LBRNGTYCTDCBDI-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 32 36  0  0  0  0  0  0  0  0999 V2000
    8.5052   -8.6881    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9397   -7.9889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1154   -7.9614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1770   -9.4979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5752  -10.2166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4014  -10.2303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8251   -9.5198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4178   -8.7973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5936   -8.7889    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3497   -9.4860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2205   -9.0981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2184   -9.9256    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6501   -9.0926    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6450   -9.9176    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3632  -10.3316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3571   -8.6760    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8584   -8.8237    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.0763   -9.0843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0819   -9.9145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.0533  -10.2512    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8806  -10.2628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.6322  -10.9618    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   18.2838  -10.9852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1058  -10.9973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.5323  -10.2859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.1234   -9.5601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.2993   -9.5534    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8929   -8.8337    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    7.7936   -9.1021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9337   -8.6835    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.8703  -10.1575    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.6500   -9.5314    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  4  5  2  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  2  0
  9  4  1  0
  4 10  1  0
  1 11  1  0
 11 12  2  0
 13 14  2  0
 14 15  1  0
 15 19  2  0
 18 16  2  0
 16 13  1  0
 18 19  1  0
 17 18  1  0
 10 17  2  0
 20 21  1  0
 20 22  2  0
 21 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 21  1  0
 27 28  1  0
  1 29  1  0
  2  1  1  0
  3  2  1  0
  1  3  1  0
 19 31  1  0
 31 10  1  0
 11 30  1  0
 30 13  1  0
  7 32  1  0
 32 20  1  0
M  END

Associated Targets(Human)

NR2E3 Tchem Photoreceptor-specific nuclear receptor (502 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 444.92Molecular Weight (Monoisotopic): 444.1353AlogP: 5.87#Rotatable Bonds: 5
Polar Surface Area: 86.88Molecular Species: NEUTRALHBA: 3HBD: 3
#RO5 Violations: 1HBA (Lipinski): 6HBD (Lipinski): 3#RO5 Violations (Lipinski): 1
CX Acidic pKa: 11.55CX Basic pKa: 5.16CX LogP: 5.55CX LogD: 5.55
Aromatic Rings: 4Heavy Atoms: 32QED Weighted: 0.36Np Likeness Score: -1.36

References

1. Wolkenberg SE, Zhao Z, Kapitskaya M, Webber AL, Petrukhin K, Tang YS, Dean DC, Hartman GD, Lindsley CW..  (2006)  Identification of potent agonists of photoreceptor-specific nuclear receptor (NR2E3) and preparation of a radioligand.,  16  (19): [PMID:16879962] [10.1016/j.bmcl.2006.07.056]

Source