The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
13-(4-trifluoromethoxy benzyl) berberine chloride ID: ALA386034
PubChem CID: 44414298
Max Phase: Preclinical
Molecular Formula: C28H23ClF3NO5
Molecular Weight: 510.49
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Synonyms: 13-(4-Trifluoromethoxy Benzyl) Berberine Chloride | 13-(4-trifluoromethoxy benzyl) berberine chloride|CHEMBL386034|VNBVNNREVLIJPH-UHFFFAOYSA-M
Canonical SMILES: COc1ccc2c(Cc3ccc(OC(F)(F)F)cc3)c3[n+](cc2c1OC)CCc1cc2c(cc1-3)OCO2.[Cl-]
Standard InChI: InChI=1S/C28H23F3NO5.ClH/c1-33-23-8-7-19-21(11-16-3-5-18(6-4-16)37-28(29,30)31)26-20-13-25-24(35-15-36-25)12-17(20)9-10-32(26)14-22(19)27(23)34-2;/h3-8,12-14H,9-11,15H2,1-2H3;1H/q+1;/p-1
Standard InChI Key: VNBVNNREVLIJPH-UHFFFAOYSA-M
Molfile:
RDKit 2D
38 42 0 0 0 0 0 0 0 0999 V2000
-4.5783 -1.8347 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-3.2753 -0.0110 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2771 1.6358 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9874 0.4003 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.9861 1.2260 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7711 1.4824 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-5.2576 0.8151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.7731 0.1463 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-2.5644 1.2281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5656 0.3983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1303 1.2261 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8491 1.6443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1315 0.3962 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8520 -0.0131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8569 -0.8397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4194 -0.0186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4208 -0.8440 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1410 -1.2553 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1439 -2.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4273 -2.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2937 -2.0837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2931 -1.2575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0049 -0.8473 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.0025 -2.4913 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7141 -2.0801 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5704 -1.2477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5738 -2.0696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2873 -2.4747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2910 -3.2958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5804 -3.7105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8646 -3.2980 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8644 -2.4784 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5827 -4.5323 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2955 -4.9413 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.0097 -5.3463 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-2.8884 -5.6552 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
-3.7035 -4.2278 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
1.7143 -1.2577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17 18 2 0
8 4 1 0
18 19 1 0
9 10 1 0
19 20 2 0
3 5 1 0
20 21 1 0
4 5 2 0
21 22 2 0
22 17 1 0
22 23 1 0
4 2 1 0
9 12 1 0
24 25 1 0
21 24 1 0
10 14 1 0
15 26 1 0
13 11 1 0
26 27 1 0
11 12 1 0
27 28 2 0
2 10 2 0
28 29 1 0
29 30 2 0
13 14 1 0
30 31 1 0
9 3 2 0
31 32 2 0
32 27 1 0
14 15 2 0
30 33 1 0
15 18 1 0
33 34 1 0
5 6 1 0
34 35 1 0
17 16 1 0
34 36 1 0
16 13 2 0
34 37 1 0
6 7 1 0
23 38 1 0
7 8 1 0
M CHG 2 1 -1 13 1
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 510.49Molecular Weight (Monoisotopic): 510.1523AlogP: 5.59#Rotatable Bonds: 5Polar Surface Area: 50.03Molecular Species: NEUTRALHBA: 5HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 2.24CX LogD: 2.24Aromatic Rings: 4Heavy Atoms: 37QED Weighted: 0.33Np Likeness Score: 0.59
References 1. Park KD, Lee JH, Kim SH, Kang TH, Moon JS, Kim SU.. (2006) Synthesis of 13-(substituted benzyl) berberine and berberrubine derivatives as antifungal agents., 16 (15): [PMID:16730982 ] [10.1016/j.bmcl.2006.05.033 ]