The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-[4-(2,6-dioxo-1,3-dipropyl-2,3,6,7-tetrahydro-1H-purin-8-yl)-bicyclo[2.2.2]oct-1-yl]-propionic acid ID: ALA386974
Max Phase: Preclinical
Molecular Formula: C22H32N4O4
Molecular Weight: 416.52
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCn1c(=O)c2nc([C@]34CC[C@](CCC(=O)O)(CC3)CC4)[nH]c2n(CCC)c1=O
Standard InChI: InChI=1S/C22H32N4O4/c1-3-13-25-17-16(18(29)26(14-4-2)20(25)30)23-19(24-17)22-10-7-21(8-11-22,9-12-22)6-5-15(27)28/h3-14H2,1-2H3,(H,23,24)(H,27,28)/t21-,22-
Standard InChI Key: ZWTVVWUOTJRXKM-HZCBDIJESA-N
Molfile:
RDKit 2D
30 33 0 0 1 0 0 0 0 0999 V2000
0.4436 -10.2118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4436 -11.0369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1522 -11.4473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8647 -11.0369 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8647 -10.2118 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1522 -9.7971 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1517 -12.2726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4876 -12.7551 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.8200 -12.7551 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.5664 -13.5400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7402 -13.5410 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3281 -14.2536 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7418 -14.9698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5680 -14.9689 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.9846 -14.2517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3271 -15.6849 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.8097 -14.2496 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4969 -14.2535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9073 -13.5382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7323 -13.5381 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9827 -15.6839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8078 -15.6838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2182 -14.9686 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1522 -8.9721 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5341 -10.4771 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7878 -10.6637 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8672 -8.5575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8672 -7.7324 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5836 -7.3189 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.1575 -7.3189 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
12 13 1 0
13 14 1 0
14 15 1 0
1 2 1 0
13 16 2 0
1 6 1 0
15 17 2 0
8 11 1 0
12 18 1 0
10 9 1 0
18 19 1 0
9 7 2 0
19 20 1 0
3 7 1 1
14 21 1 0
10 11 2 0
21 22 1 0
2 3 1 0
22 23 1 0
3 4 1 0
6 24 1 1
4 5 1 0
6 25 1 0
5 6 1 0
25 26 1 0
3 26 1 0
7 8 1 0
24 27 1 0
27 28 1 0
10 15 1 0
11 12 1 0
28 29 1 0
28 30 2 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: YesOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 416.52Molecular Weight (Monoisotopic): 416.2424AlogP: 3.16#Rotatable Bonds: 8Polar Surface Area: 109.98Molecular Species: ACIDHBA: 6HBD: 2#RO5 Violations: ┄HBA (Lipinski): 8HBD (Lipinski): 2#RO5 Violations (Lipinski): ┄CX Acidic pKa: 4.16CX Basic pKa: 2.45CX LogP: 3.29CX LogD: 0.33Aromatic Rings: 2Heavy Atoms: 30QED Weighted: 0.69Np Likeness Score: -0.08
References 1. Kiesman WF, Zhao J, Conlon PR, Dowling JE, Petter RC, Lutterodt F, Jin X, Smits G, Fure M, Jayaraj A, Kim J, Sullivan G, Linden J.. (2006) Potent and orally bioavailable 8-bicyclo[2.2.2]octylxanthines as adenosine A1 receptor antagonists., 49 (24): [PMID:17125264 ] [10.1021/jm0605381 ]