The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
(E)-N-(2-Dimethylamino-ethyl)-3-[4-((Z)-1,2-diphenyl-but-1-enyl)-phenyl]-N-ethyl-acrylamide ID: ALA38797
PubChem CID: 9846700
Max Phase: Preclinical
Molecular Formula: C31H36N2O
Molecular Weight: 452.64
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: CC/C(=C(\c1ccccc1)c1ccc(/C=C/C(=O)N(CC)CCN(C)C)cc1)c1ccccc1
Standard InChI: InChI=1S/C31H36N2O/c1-5-29(26-13-9-7-10-14-26)31(27-15-11-8-12-16-27)28-20-17-25(18-21-28)19-22-30(34)33(6-2)24-23-32(3)4/h7-22H,5-6,23-24H2,1-4H3/b22-19+,31-29-
Standard InChI Key: GUDMGLNHTKZVJR-NSEFVXCXSA-N
Molfile:
RDKit 2D
34 36 0 0 0 0 0 0 0 0999 V2000
4.0917 -4.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8125 -5.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7917 -0.1667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7917 -0.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0917 -3.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5042 0.2500 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
4.0792 -1.4042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3792 -5.1167 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5250 -4.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0750 0.2458 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
6.2167 -0.1542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3792 -3.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8042 -3.4667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.0875 -2.2292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9292 -1.4000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
6.2167 -0.9917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8042 -2.6417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3667 -2.6542 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.8125 -5.9375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5000 1.0750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6667 -4.7042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2375 -5.1125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5167 -3.8792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3792 -5.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9375 -2.2250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.6417 -0.9792 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.5292 -6.3500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.7792 1.4833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9500 -4.6917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.2250 -3.4625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9542 -5.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6667 -6.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.9500 -3.8667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.9542 -5.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2 1 2 0
3 4 1 0
4 7 2 0
5 1 1 0
6 3 1 0
7 14 1 0
8 1 1 0
9 2 1 0
10 3 2 0
11 6 1 0
12 5 1 0
13 5 2 0
14 17 2 0
15 16 1 0
16 11 1 0
17 13 1 0
18 12 2 0
19 2 1 0
20 6 1 0
21 8 2 0
22 9 2 0
23 9 1 0
24 8 1 0
25 15 1 0
26 15 1 0
27 19 1 0
28 20 1 0
29 22 1 0
30 23 2 0
31 21 1 0
32 24 2 0
33 30 1 0
34 32 1 0
14 18 1 0
34 31 2 0
33 29 2 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 452.64Molecular Weight (Monoisotopic): 452.2828AlogP: 6.48#Rotatable Bonds: 10Polar Surface Area: 23.55Molecular Species: NEUTRALHBA: 2HBD: ┄#RO5 Violations: 1HBA (Lipinski): 3HBD (Lipinski): ┄#RO5 Violations (Lipinski): 1CX Acidic pKa: ┄CX Basic pKa: 8.46CX LogP: 6.67CX LogD: 5.57Aromatic Rings: 3Heavy Atoms: 34QED Weighted: 0.26Np Likeness Score: -0.43
References 1. Willson TM, Henke BR, Momtahen TM, Charifson PS, Batchelor KW, Lubahn DB, Moore LB, Oliver BB, Sauls HR, Triantafillou JA.. (1994) 3-[4-(1,2-Diphenylbut-1-enyl)phenyl]acrylic acid: a non-steroidal estrogen with functional selectivity for bone over uterus in rats., 37 (11): [PMID:8201587 ] [10.1021/jm00037a002 ]