The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
3-(7'-[1-(3,4-dichlorophenyl)-5-tetrazolylthio]heptyloxy)-estra-1,3,5(10)-triene-17-one ID: ALA388201
PubChem CID: 44424946
Max Phase: Preclinical
Molecular Formula: C32H38Cl2N4O2S
Molecular Weight: 613.66
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: C[C@]12CC[C@@H]3c4ccc(OCCCCCCCSc5nnnn5-c5ccc(Cl)c(Cl)c5)cc4CC[C@H]3[C@@H]1CCC2=O
Standard InChI: InChI=1S/C32H38Cl2N4O2S/c1-32-16-15-25-24-11-9-23(19-21(24)7-10-26(25)27(32)12-14-30(32)39)40-17-5-3-2-4-6-18-41-31-35-36-37-38(31)22-8-13-28(33)29(34)20-22/h8-9,11,13,19-20,25-27H,2-7,10,12,14-18H2,1H3/t25-,26-,27+,32+/m1/s1
Standard InChI Key: LDJHPZJURGYROX-WEBZSHJMSA-N
Molfile:
RDKit 2D
44 49 0 0 1 0 0 0 0 0999 V2000
6.3250 -9.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.3250 -10.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0370 -10.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.0370 -8.8500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7490 -9.2667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.7501 -10.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4611 -10.5010 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1757 -10.0898 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4590 -8.8510 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1743 -9.2695 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1822 -7.6151 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4599 -8.0246 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8930 -8.0318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.8872 -8.8626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6756 -9.1248 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.1686 -8.4561 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.6849 -7.7806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.1667 -8.4417 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.8875 -7.2042 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.4542 -9.6750 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
9.8792 -9.6875 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0
10.9453 -6.9978 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
5.6111 -10.5052 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.8961 -10.0937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.1822 -10.5073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4671 -10.0958 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7532 -10.5094 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0382 -10.0979 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.3243 -10.5114 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6092 -10.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1046 -10.5136 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
-0.8197 -10.1022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9099 -9.2817 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.7172 -9.1114 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-2.1285 -9.8265 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.5756 -10.4388 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.2985 -8.7277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.4840 -8.9837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0951 -8.4305 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9212 -7.6231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1309 -7.3719 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4767 -7.9268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5318 -7.0684 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
-0.0460 -6.5661 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
11 12 1 0
28 29 1 0
13 14 1 0
29 30 1 0
1 2 1 0
1 4 2 0
5 9 1 0
14 15 1 0
15 16 1 0
16 17 1 0
17 13 1 0
6 7 1 0
10 18 1 1
7 8 1 0
13 19 1 1
8 10 1 0
9 20 1 6
9 10 1 0
14 21 1 6
2 3 2 0
30 31 1 0
17 22 2 0
31 32 1 0
35 36 1 0
3 6 1 0
33 34 1 0
2 23 1 0
5 4 1 0
23 24 1 0
32 33 1 0
34 35 2 0
36 32 2 0
5 6 2 0
33 37 1 0
24 25 1 0
37 38 2 0
9 12 1 0
38 39 1 0
25 26 1 0
39 40 2 0
10 14 1 0
40 41 1 0
26 27 1 0
41 42 2 0
42 37 1 0
13 11 1 0
40 43 1 0
27 28 1 0
41 44 1 0
M END Associated Targets(Human) Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 613.66Molecular Weight (Monoisotopic): 612.2093AlogP: 8.52#Rotatable Bonds: 11Polar Surface Area: 69.90Molecular Species: NEUTRALHBA: 7HBD: ┄#RO5 Violations: 2HBA (Lipinski): 6HBD (Lipinski): ┄#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: ┄CX LogP: 9.62CX LogD: 9.62Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.16Np Likeness Score: -0.62
References 1. Adamec J, Beckert R, Weiss D, Klimesová V, Waisser K, Möllmann U, Kaustová J, Buchta V.. (2007) Hybrid molecules of estrone: new compounds with potential antibacterial, antifungal, and antiproliferative activities., 15 (8): [PMID:17321746 ] [10.1016/j.bmc.2007.02.021 ] 2. Gao C, Chang L, Xu Z, Yan XF, Ding C, Zhao F, Wu X, Feng LS.. (2019) Recent advances of tetrazole derivatives as potential anti-tubercular and anti-malarial agents., 163 [PMID:30530192 ] [10.1016/j.ejmech.2018.12.001 ]