The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
5-amino-N-(4'-(4-aminobutanamido)-4-(4-methylpiperazin-1-yl)-[1,1'-biphenyl]-3-yl)-2-chloro-4-fluoro-3-methylbenzamide ID: ALA3884329
PubChem CID: 134130757
Max Phase: Preclinical
Molecular Formula: C29H34ClFN6O2
Molecular Weight: 553.08
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(F)c(N)cc(C(=O)Nc2cc(-c3ccc(NC(=O)CCCN)cc3)ccc2N2CCN(C)CC2)c1Cl
Standard InChI: InChI=1S/C29H34ClFN6O2/c1-18-27(30)22(17-23(33)28(18)31)29(39)35-24-16-20(7-10-25(24)37-14-12-36(2)13-15-37)19-5-8-21(9-6-19)34-26(38)4-3-11-32/h5-10,16-17H,3-4,11-15,32-33H2,1-2H3,(H,34,38)(H,35,39)
Standard InChI Key: PVXYYWORFYROCX-UHFFFAOYSA-N
Molfile:
RDKit 2D
39 42 0 0 0 0 0 0 0 0999 V2000
18.4616 -10.4204 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1731 -10.8284 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.1733 -11.6475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8807 -12.0555 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5881 -11.6486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.5879 -10.8295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8805 -10.4173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8808 -12.8747 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
18.4614 -9.6013 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.7542 -10.8273 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.0468 -10.4193 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0467 -9.6002 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3392 -9.1880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6277 -9.5991 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6279 -10.4182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3394 -10.8262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3396 -11.6453 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.0470 -12.0534 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0471 -12.8725 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3357 -13.2836 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.6282 -12.8714 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6281 -12.0523 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3358 -14.1027 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3391 -8.3689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6275 -7.9609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.6274 -7.1418 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3388 -6.7348 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0463 -7.1429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0464 -7.9620 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
21.2955 -12.0577 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
21.2964 -10.4222 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.8809 -9.6001 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
16.3403 -5.9176 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.0487 -5.5103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.0502 -4.6931 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
17.7557 -5.9202 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
17.0586 -3.0605 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.3484 -3.4666 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.3433 -4.2864 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
2 7 2 0
4 8 1 0
1 9 2 0
1 10 1 0
10 11 1 0
12 11 2 0
13 12 1 0
13 14 2 0
15 14 1 0
16 15 2 0
11 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
17 22 1 0
20 23 1 0
13 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
24 29 2 0
5 30 1 0
6 31 1 0
7 32 1 0
27 33 1 0
33 34 1 0
34 35 1 0
34 36 2 0
35 39 1 0
37 38 1 0
38 39 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 553.08Molecular Weight (Monoisotopic): 552.2416AlogP: 4.72#Rotatable Bonds: 8Polar Surface Area: 116.72Molecular Species: BASEHBA: 6HBD: 4#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 6#RO5 Violations (Lipinski): 2CX Acidic pKa: ┄CX Basic pKa: 9.99CX LogP: 3.94CX LogD: 1.06Aromatic Rings: 3Heavy Atoms: 39QED Weighted: 0.30Np Likeness Score: -1.22
References 1. Li DD, Chen WL, Wang ZH, Xie YY, Xu XL, Jiang ZY, Zhang XJ, You QD, Guo XK.. (2016) High-affinity small molecular blockers of mixed lineage leukemia 1 (MLL1)-WDR5 interaction inhibit MLL1 complex H3K4 methyltransferase activity., 124 [PMID:27598236 ] [10.1016/j.ejmech.2016.08.036 ] 2. Chen W, Chen X, Li D, Wang X, Long G, Jiang Z, You Q, Guo X.. (2021) Discovery of a potent MLL1 and WDR5 protein-protein interaction inhibitor with in vivo antitumor activity., 223 [PMID:34225179 ] [10.1016/j.ejmech.2021.113677 ]