The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
N-(3'-(5-amino-2-chloro-4-fluoro-3-methylbenzamido)-4'-(4-methylpiperazin-1-yl)-[1,1'-biphenyl]-4-yl)piperidine-4-carboxamide ID: ALA3884726
PubChem CID: 134130592
Max Phase: Preclinical
Molecular Formula: C31H36ClFN6O2
Molecular Weight: 579.12
Molecule Type: Small molecule
This compound is available for customization.
Associated Items:
Names and Identifiers Canonical SMILES: Cc1c(F)c(N)cc(C(=O)Nc2cc(-c3ccc(NC(=O)C4CCNCC4)cc3)ccc2N2CCN(C)CC2)c1Cl
Standard InChI: InChI=1S/C31H36ClFN6O2/c1-19-28(32)24(18-25(34)29(19)33)31(41)37-26-17-22(5-8-27(26)39-15-13-38(2)14-16-39)20-3-6-23(7-4-20)36-30(40)21-9-11-35-12-10-21/h3-8,17-18,21,35H,9-16,34H2,1-2H3,(H,36,40)(H,37,41)
Standard InChI Key: CZWZZEUKNASAHM-UHFFFAOYSA-N
Molfile:
RDKit 2D
41 45 0 0 0 0 0 0 0 0999 V2000
17.5948 -11.5677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3064 -11.9758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
18.3065 -12.7949 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0140 -13.2029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7213 -12.7960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.7212 -11.9769 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0138 -11.5647 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0141 -14.0220 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
17.5947 -10.7486 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8875 -11.9747 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.1801 -11.5667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1799 -10.7475 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4725 -10.3354 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7610 -10.7465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7611 -11.5656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4727 -11.9736 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4728 -12.7927 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.1803 -13.2007 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1804 -14.0199 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4690 -14.4309 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
14.7615 -14.0188 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7614 -13.1997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4691 -15.2500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4724 -9.5163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7608 -9.1082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
14.7606 -8.2891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4721 -7.8822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1796 -8.2902 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1797 -9.1093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20.4288 -13.2050 0.0000 F 0 0 0 0 0 0 0 0 0 0 0 0
20.4297 -11.5696 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
19.0142 -10.7475 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0
15.4736 -7.0650 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
16.1820 -6.6577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1835 -5.8405 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8890 -7.0675 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
16.8936 -5.4352 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.8970 -4.6216 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
16.1919 -4.2079 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
15.4816 -4.6140 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
15.4765 -5.4338 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
2 7 2 0
4 8 1 0
1 9 2 0
1 10 1 0
10 11 1 0
12 11 2 0
13 12 1 0
13 14 2 0
15 14 1 0
16 15 2 0
11 16 1 0
16 17 1 0
17 18 1 0
18 19 1 0
19 20 1 0
20 21 1 0
21 22 1 0
17 22 1 0
20 23 1 0
13 24 1 0
24 25 1 0
25 26 2 0
26 27 1 0
27 28 2 0
28 29 1 0
24 29 2 0
5 30 1 0
6 31 1 0
7 32 1 0
27 33 1 0
33 34 1 0
34 35 1 0
34 36 2 0
35 37 1 0
35 41 1 0
37 38 1 0
38 39 1 0
39 40 1 0
40 41 1 0
M END Associated Targets(Human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 579.12Molecular Weight (Monoisotopic): 578.2572AlogP: 4.98#Rotatable Bonds: 6Polar Surface Area: 102.73Molecular Species: BASEHBA: 6HBD: 4#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): 1CX Acidic pKa: 13.91CX Basic pKa: 10.17CX LogP: 4.44CX LogD: 1.38Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.31Np Likeness Score: -1.34
References 1. Li DD, Chen WL, Wang ZH, Xie YY, Xu XL, Jiang ZY, Zhang XJ, You QD, Guo XK.. (2016) High-affinity small molecular blockers of mixed lineage leukemia 1 (MLL1)-WDR5 interaction inhibit MLL1 complex H3K4 methyltransferase activity., 124 [PMID:27598236 ] [10.1016/j.ejmech.2016.08.036 ]