N-(3'-(5-amino-2-chloro-4-fluoro-3-methylbenzamido)-4'-(4-methylpiperazin-1-yl)-[1,1'-biphenyl]-4-yl)piperidine-4-carboxamide

ID: ALA3884726

PubChem CID: 134130592

Max Phase: Preclinical

Molecular Formula: C31H36ClFN6O2

Molecular Weight: 579.12

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Cc1c(F)c(N)cc(C(=O)Nc2cc(-c3ccc(NC(=O)C4CCNCC4)cc3)ccc2N2CCN(C)CC2)c1Cl

Standard InChI:  InChI=1S/C31H36ClFN6O2/c1-19-28(32)24(18-25(34)29(19)33)31(41)37-26-17-22(5-8-27(26)39-15-13-38(2)14-16-39)20-3-6-23(7-4-20)36-30(40)21-9-11-35-12-10-21/h3-8,17-18,21,35H,9-16,34H2,1-2H3,(H,36,40)(H,37,41)

Standard InChI Key:  CZWZZEUKNASAHM-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 41 45  0  0  0  0  0  0  0  0999 V2000
   17.5948  -11.5677    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3064  -11.9758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.3065  -12.7949    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0140  -13.2029    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7213  -12.7960    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.7212  -11.9769    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0138  -11.5647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0141  -14.0220    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   17.5947  -10.7486    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.8875  -11.9747    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.1801  -11.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1799  -10.7475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4725  -10.3354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7610  -10.7465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7611  -11.5656    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4727  -11.9736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4728  -12.7927    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.1803  -13.2007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1804  -14.0199    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4690  -14.4309    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.7615  -14.0188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7614  -13.1997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4691  -15.2500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4724   -9.5163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7608   -9.1082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.7606   -8.2891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4721   -7.8822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1796   -8.2902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1797   -9.1093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.4288  -13.2050    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   20.4297  -11.5696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.0142  -10.7475    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   15.4736   -7.0650    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   16.1820   -6.6577    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1835   -5.8405    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8890   -7.0675    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.8936   -5.4352    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.8970   -4.6216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.1919   -4.2079    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.4816   -4.6140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.4765   -5.4338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  2  7  2  0
  4  8  1  0
  1  9  2  0
  1 10  1  0
 10 11  1  0
 12 11  2  0
 13 12  1  0
 13 14  2  0
 15 14  1  0
 16 15  2  0
 11 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 17 22  1  0
 20 23  1  0
 13 24  1  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  2  0
 28 29  1  0
 24 29  2  0
  5 30  1  0
  6 31  1  0
  7 32  1  0
 27 33  1  0
 33 34  1  0
 34 35  1  0
 34 36  2  0
 35 37  1  0
 35 41  1  0
 37 38  1  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
M  END

Alternative Forms

  1. Parent:

    ALA3884726

    ---

Associated Targets(Human)

WDR5 Tchem MLL1/ASH2L/RBBP5/WDR5 complex (16 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
WDR5 Tchem WD repeat-containing protein 5 (979 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 579.12Molecular Weight (Monoisotopic): 578.2572AlogP: 4.98#Rotatable Bonds: 6
Polar Surface Area: 102.73Molecular Species: BASEHBA: 6HBD: 4
#RO5 Violations: 1HBA (Lipinski): 8HBD (Lipinski): 5#RO5 Violations (Lipinski): 1
CX Acidic pKa: 13.91CX Basic pKa: 10.17CX LogP: 4.44CX LogD: 1.38
Aromatic Rings: 3Heavy Atoms: 41QED Weighted: 0.31Np Likeness Score: -1.34

References

1. Li DD, Chen WL, Wang ZH, Xie YY, Xu XL, Jiang ZY, Zhang XJ, You QD, Guo XK..  (2016)  High-affinity small molecular blockers of mixed lineage leukemia 1 (MLL1)-WDR5 interaction inhibit MLL1 complex H3K4 methyltransferase activity.,  124  [PMID:27598236] [10.1016/j.ejmech.2016.08.036]

Source