The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
1,2-O-dilauroyl-3-O-(beta-D-glucopyranosyl)-rac-glycerol ID: ALA388740
Cas Number: 147514-22-5
PubChem CID: 132801
Max Phase: Preclinical
Molecular Formula: C33H62O10
Molecular Weight: 618.85
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CCCCCCCCCCCC(=O)OCC(CO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)OC(=O)CCCCCCCCCCC
Standard InChI: InChI=1S/C33H62O10/c1-3-5-7-9-11-13-15-17-19-21-28(35)40-24-26(25-41-33-32(39)31(38)30(37)27(23-34)43-33)42-29(36)22-20-18-16-14-12-10-8-6-4-2/h26-27,30-34,37-39H,3-25H2,1-2H3/t26?,27-,30-,31+,32-,33-/m1/s1
Standard InChI Key: BIOJTMVLNXQLNJ-BBEDEGKMSA-N
Molfile:
RDKit 2D
43 43 0 0 1 0 0 0 0 0999 V2000
-2.5708 -11.7333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5708 -12.5583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8588 -12.9667 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1468 -12.5583 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.1468 -11.7333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.8588 -11.3167 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4311 -11.3229 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.4329 -12.9719 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.8588 -13.7917 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2847 -12.9719 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.2865 -11.3229 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.2889 -10.4979 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.2821 -11.7375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9978 -11.3271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7111 -11.7417 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0002 -10.5021 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1.7159 -10.0917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7183 -9.2667 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4268 -11.3313 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
3.1448 -10.0959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8581 -10.5105 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.5738 -10.1001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2870 -10.5147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.0027 -10.1043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7160 -10.5189 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4292 -10.5063 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1400 -11.7459 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.8557 -11.3355 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1376 -12.5709 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
4.5689 -11.7501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.2846 -11.3397 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.9979 -11.7543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4268 -11.7585 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
6.7136 -11.3439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
7.4317 -10.1085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1449 -10.5231 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8558 -11.7626 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5714 -11.3522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.1425 -11.3480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
8.8606 -10.1126 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
9.5738 -10.5272 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
10.2847 -11.7668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
11.0004 -11.3564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
20 21 1 0
3 4 1 0
21 22 1 0
1 11 1 1
22 23 1 0
4 5 1 0
23 24 1 0
11 12 1 0
24 25 1 0
5 6 1 0
7 13 1 0
19 27 1 0
27 28 1 0
13 14 1 0
27 29 2 0
5 7 1 1
28 30 1 0
14 15 1 0
30 31 1 0
1 2 1 0
31 32 1 0
32 34 1 0
14 16 1 0
34 33 1 0
33 39 1 0
15 19 1 0
4 8 1 6
25 35 1 0
35 36 1 0
16 17 1 0
1 6 1 0
39 37 1 0
17 18 2 0
37 38 1 0
17 26 1 0
3 9 1 1
36 40 1 0
2 3 1 0
40 41 1 0
26 20 1 0
38 42 1 0
2 10 1 6
42 43 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 618.85Molecular Weight (Monoisotopic): 618.4343AlogP: 5.10#Rotatable Bonds: 27Polar Surface Area: 151.98Molecular Species: NEUTRALHBA: 10HBD: 4#RO5 Violations: 2HBA (Lipinski): 10HBD (Lipinski): 4#RO5 Violations (Lipinski): 2CX Acidic pKa: 12.21CX Basic pKa: ┄CX LogP: 6.68CX LogD: 6.68Aromatic Rings: ┄Heavy Atoms: 43QED Weighted: 0.07Np Likeness Score: 1.04
References 1. Cateni F, Bonivento P, Procida G, Zacchigna M, Gabrielli Favretto L, Scialino G, Banfi E.. (2007) Chemoenzymatic synthesis and antimicrobial activity evaluation of monoglucosyl diglycerides., 15 (2): [PMID:17088068 ] [10.1016/j.bmc.2006.10.045 ] 2. Cateni F, Bonivento P, Procida G, Zacchigna M, Scialino G, Banfi E.. (2007) Chemoenzymatic synthesis and in vitro studies on the hydrolysis of antimicrobial monoglycosyl diglycerides by pancreatic lipase., 17 (7): [PMID:17270436 ] [10.1016/j.bmcl.2007.01.019 ]