The store will not work correctly when cookies are disabled.
JavaScript seems to be disabled in your browser. For the best experience on our site, be sure to turn on Javascript in your browser.
US8487093, 210 ID: ALA3889864
PubChem CID: 58530007
Max Phase: Preclinical
Molecular Formula: C11H17N5O6S
Molecular Weight: 347.35
Molecule Type: Small molecule
Associated Items:
Names and Identifiers Canonical SMILES: CN1CCN=C1NC(=O)[C@@H]1CC[C@@H]2CN1C(=O)N2OS(=O)(=O)O
Standard InChI: InChI=1S/C11H17N5O6S/c1-14-5-4-12-10(14)13-9(17)8-3-2-7-6-15(8)11(18)16(7)22-23(19,20)21/h7-8H,2-6H2,1H3,(H,12,13,17)(H,19,20,21)/t7-,8+/m1/s1
Standard InChI Key: AIZGEXNWBOUBOP-SFYZADRCSA-N
Molfile:
RDKit 2D
23 25 0 0 1 0 0 0 0 0999 V2000
6.1777 1.9927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
5.3545 2.8658 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
5.6239 4.3414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
4.3037 5.0535 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.2185 4.0181 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
3.8783 2.6852 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1630 1.3657 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
1.6628 1.3245 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0348 2.3471 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9488 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8975 -0.8028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6421 0.6933 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0000 0.6568 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0947 1.4779 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8393 0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8063 -1.3319 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6902 -2.1435 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6568 -0.6386 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0
0.4080 -1.7063 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0178 -3.1555 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0
0.8648 -4.0056 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.1417 -3.4643 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2947 -4.3141 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 2 0
6 2 1 0
6 7 1 0
7 8 1 0
8 9 2 0
10 8 1 6
10 11 1 0
11 12 1 0
13 12 1 1
13 14 1 0
14 15 1 0
15 10 1 0
15 16 1 0
16 17 2 0
16 18 1 0
18 13 1 0
18 19 1 0
19 20 1 0
20 21 2 0
20 22 2 0
20 23 1 0
M END Associated Targets(non-human) Molecule Features Natural Product: NoOral: NoChemical Probe: NoParenteral: NoMolecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: NoChirality: NoAvailability: NoProdrug: No
Drug Indications MESH ID MESH Heading EFO IDs EFO Terms Max Phase for Indication References
Mechanisms of Action Mechanism of Action Action Type target ID Target Name Target Type Target Organism Binding Site Name References
Calculated Properties Molecular Weight: 347.35Molecular Weight (Monoisotopic): 347.0900AlogP: -1.59#Rotatable Bonds: 3Polar Surface Area: 131.85Molecular Species: ACIDHBA: 7HBD: 2#RO5 Violations: ┄HBA (Lipinski): 11HBD (Lipinski): 2#RO5 Violations (Lipinski): 1CX Acidic pKa: -2.07CX Basic pKa: 6.37CX LogP: -1.84CX LogD: -2.86Aromatic Rings: ┄Heavy Atoms: 23QED Weighted: 0.59Np Likeness Score: -0.51
References 1. (2013) Œ=-lactamase inhibitors,