2-{4-[(2-Amino-4-oxo-3,4,5,6,7,8-hexahydro-pyrido[2,3-d]pyrimidin-6-ylmethyl)-amino]-benzoylamino}-4-phosphono-butyric acid

ID: ALA38902

PubChem CID: 135887106

Max Phase: Preclinical

Molecular Formula: C19H25N6O7P

Molecular Weight: 480.42

Molecule Type: Small molecule

This compound is available for customization.

Associated Items:

Names and Identifiers

Canonical SMILES:  Nc1nc(O)c2c(n1)NCC(CNc1ccc(C(=O)NC(CCP(=O)(O)O)C(=O)O)cc1)C2

Standard InChI:  InChI=1S/C19H25N6O7P/c20-19-24-15-13(17(27)25-19)7-10(9-22-15)8-21-12-3-1-11(2-4-12)16(26)23-14(18(28)29)5-6-33(30,31)32/h1-4,10,14,21H,5-9H2,(H,23,26)(H,28,29)(H2,30,31,32)(H4,20,22,24,25,27)

Standard InChI Key:  SGOILMDABCVEJA-UHFFFAOYSA-N

Molfile:  

     RDKit          2D

 33 35  0  0  0  0  0  0  0  0999 V2000
    2.4125   -4.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8917   -4.3667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4125   -3.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3750   -3.4667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8917   -3.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3750   -4.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1667   -2.5625    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    2.9292   -4.3667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5667   -2.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0917   -2.5667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6125   -1.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6125   -2.2667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9292   -3.1542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0542   -2.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8875   -2.5625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.1292   -2.5625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3042   -1.9792    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5667   -1.6667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6500   -2.2625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1292   -1.3625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4542   -3.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8542   -4.3667    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4917   -3.4625    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4542   -4.0667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7417   -2.7167    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.0125   -3.1417    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0500   -3.1667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5292   -2.2625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0125   -3.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9750   -3.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0917   -1.3667    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0125   -2.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5292   -3.4625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0
  3  1  1  0
  4  5  1  0
  5  3  2  0
  6  2  1  0
  7 19  1  0
  8  1  1  0
  9 14  1  0
 10  9  1  0
 11 12  1  0
 12 10  1  0
 13  3  1  0
 14 27  2  0
 15  5  1  0
 16 12  1  0
 17  7  2  0
 18  9  2  0
 19 16  1  0
 20 11  2  0
 21 24  1  0
 22  6  1  0
 23 30  1  0
 24  8  1  0
 25  7  1  0
 26  7  1  0
 27 33  1  0
 28 32  2  0
 29 23  1  0
 30 21  1  0
 31 11  1  0
 32 29  1  0
 33 29  2  0
  4  6  2  0
 13 21  1  0
 28 14  1  0
M  END

Alternative Forms

  1. Parent:

    ALA38902

    ---

Associated Targets(Human)

DHFR Tclin Dihydrofolate reductase (3072 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
TYMS Tclin Thymidylate synthase (1651 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Associated Targets(non-human)

Fpgs Folylpoly-gamma-glutamate synthetase (93 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID
Gart GAR transformylase (71 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Small moleculeTopical: NoFirst In Class: NoBlack Box: No
Chirality: NoAvailability: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferences

Mechanisms of Action

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferences

Calculated Properties

Molecular Weight: 480.42Molecular Weight (Monoisotopic): 480.1522AlogP: 0.21#Rotatable Bonds: 9
Polar Surface Area: 220.02Molecular Species: ACIDHBA: 9HBD: 8
#RO5 Violations: 1HBA (Lipinski): 13HBD (Lipinski): 9#RO5 Violations (Lipinski): 2
CX Acidic pKa: 1.80CX Basic pKa: 4.17CX LogP: -2.82CX LogD: -6.39
Aromatic Rings: 2Heavy Atoms: 33QED Weighted: 0.23Np Likeness Score: -0.05

References

1. Rosowsky A, Forsch RA, Reich VE, Freisheim JH, Moran RG..  (1992)  Side chain modified 5-deazafolate and 5-deazatetrahydrofolate analogues as mammalian folylpolyglutamate synthetase and glycinamide ribonucleotide formyltransferase inhibitors: synthesis and in vitro biological evaluation.,  35  (9): [PMID:1578484] [10.1021/jm00087a012]

Source